Name | 5-[(1r,3ar,4s,6as)-4-(3,4,5-trimethoxyphenyl)-hexahydrofuro[3,4-c]furan-1-yl]-2h-1,3-benzodioxole |
Wikidata | Q105194612 |
Mol. formula | C22H24O7 |
CAS registry number | - |
Mol. weight | 400.4226 |
Temporary LOTUS id | LTS0233145 |
Name | 5-[(1r,3ar,4s,6as)-4-(3,4,5-trimethoxyphenyl)-hexahydrofuro[3,4-c]furan-1-yl]-2h-1,3-benzodioxole |
Canonical SMILES | COc1cc([C@H]2OC[C@H]3[C@H](c4ccc5c(c4)OCO5)OC[C@H]23)cc(OC)c1OC |
2D SMILES | COc1cc(C2OCC3C(c4ccc5c(c4)OCO5)OCC23)cc(OC)c1OC |
IUPAC name | 5-[(1R,3aR,4S,6aS)-4-(3,4,5-trimethoxyphenyl)-hexahydrofuro[3,4-c]furan-1-yl]-2H-1,3-benzodioxole |
InChI | InChI=1S/C22H24O7/c1-23-18-7-13(8-19(24-2)22(18)25-3)21-15-10-26-20(14(15)9-27-21)12-4-5-16-17(6-12)29-11-28-16/h4-8,14-15,20-21H,9-11H2,1-3H3/t14-,15+,20+,21-/m1/s1 |
InChIKey | ONDWGDNAFRAXCN-UGCQDJOBSA-N |
Deep SMILES | could not be computed |
Murcko Framework | O1c2ccc(cc2OC1)C3OCC4C(OCC34)c5ccccc5 |
Pathway | Superclass | Class |
Shikimates and Phenylpropanoids | Lignans | Furofuranoid lignans |
Total atom number | 53 |
Heavy atom number | 29 |
Bond count | 33 |
Number of carbons | 22 |
Minimal number of rings | 5 |
Maximal number of rings | 7 |
NP-likeness score | 1 |
Alogp | 2.42 |
Alogp2 | 5.85 |
Apol | 60.337 |
Bpol | 39.649 |
EccentricConnectivityIndexDescriptor | 700 |
FmfDescriptor | 0.7931 |
Fsp3 | 0.4545 |
FragmentComplexityDescriptor | 2437.07 |
PetitjeanNumber | 0.5 |
LipinskiRuleOf5Failures | 0 |
WienerPathNumber | 2270 |
Xlogp | 2.734 |
ZagrebIndex | 162 |
TopoPSA | 64.61 |