Name | 5-[3-(4-hydroxy-2-methoxyphenyl)propyl]-2-methoxyphenol |
Wikidata | Q82762216 |
Mol. formula | C17H20O4 |
CAS registry number | - |
Mol. weight | 288.3389 |
Temporary LOTUS id | LTS0232864 |
Name | 5-[3-(4-hydroxy-2-methoxyphenyl)propyl]-2-methoxyphenol |
Canonical SMILES | COc1ccc(CCCc2ccc(O)cc2OC)cc1O |
2D SMILES | COc1ccc(CCCc2ccc(O)cc2OC)cc1O |
IUPAC name | 5-[3-(4-hydroxy-2-methoxyphenyl)propyl]-2-methoxyphenol |
InChI | InChI=1S/C17H20O4/c1-20-16-9-6-12(10-15(16)19)4-3-5-13-7-8-14(18)11-17(13)21-2/h6-11,18-19H,3-5H2,1-2H3 |
InChIKey | MGQGOPWLZUGCMO-UHFFFAOYSA-N |
Deep SMILES | could not be computed |
Murcko Framework | c1ccc(cc1)CCCc2ccccc2 |
Pathway | Superclass | Class |
Polyketides | Aromatic polyketides | Catechols with side chains |
Total atom number | 41 |
Heavy atom number | 21 |
Bond count | 22 |
Number of carbons | 17 |
Minimal number of rings | 2 |
Maximal number of rings | 2 |
NP-likeness score | 1 |
Alogp | 4.15 |
Alogp2 | 17.22 |
Apol | 46.4639 |
Bpol | 25.6961 |
EccentricConnectivityIndexDescriptor | 439 |
FmfDescriptor | 0.7143 |
Fsp3 | 0.2941 |
FragmentComplexityDescriptor | 1344.04 |
PetitjeanNumber | 0.4615 |
LipinskiRuleOf5Failures | 0 |
WienerPathNumber | 1078 |
Xlogp | 3.476 |
ZagrebIndex | 102 |
TopoPSA | 58.92 |