Name | Methyl (1r,2r)-1,2,8-trihydroxy-9-oxo-3,4-dihydro-2h-xanthene-1-carboxylate |
Wikidata | Q105369719 |
Mol. formula | C15H14O7 |
CAS registry number | - |
Mol. weight | 306.268 |
Temporary LOTUS id | LTS0232806 |
Name | Methyl (1r,2r)-1,2,8-trihydroxy-9-oxo-3,4-dihydro-2h-xanthene-1-carboxylate |
Canonical SMILES | COC(=O)[C@@]1(O)c2c(oc3cccc(O)c3c2=O)CC[C@H]1O |
2D SMILES | COC(=O)C1(O)c2c(oc3cccc(O)c3c2=O)CCC1O |
IUPAC name | methyl (1R,2R)-1,2,8-trihydroxy-9-oxo-2,3,4,9-tetrahydro-1H-xanthene-1-carboxylate |
InChI | InChI=1S/C15H14O7/c1-21-14(19)15(20)10(17)6-5-9-12(15)13(18)11-7(16)3-2-4-8(11)22-9/h2-4,10,16-17,20H,5-6H2,1H3/t10-,15+/m1/s1 |
InChIKey | ZABNGICOOSPAKV-BMIGLBTASA-N |
Deep SMILES | could not be computed |
Murcko Framework | O1c2ccccc2CC3=C1CCCC3 |
Pathway | Superclass | Class |
Polyketides|Polyketides | Xanthones|Xanthones | |Methyl xanthones |
Total atom number | 36 |
Heavy atom number | 22 |
Bond count | 24 |
Number of carbons | 15 |
Minimal number of rings | 3 |
Maximal number of rings | 6 |
NP-likeness score | 1.45 |
Alogp | 0.84 |
Alogp2 | 0.71 |
Apol | 41.3491 |
Bpol | 21.0529 |
EccentricConnectivityIndexDescriptor | 321 |
FmfDescriptor | 0.6364 |
Fsp3 | 0.3333 |
FragmentComplexityDescriptor | 982.07 |
PetitjeanNumber | 0.4444 |
LipinskiRuleOf5Failures | 0 |
WienerPathNumber | 890 |
Xlogp | 1.482 |
ZagrebIndex | 122 |
TopoPSA | 117.2 |