Name | (5z)-5-[(4e)-5-(methylsulfanyl)hex-4-en-2-yn-1-ylidene]furan-2-one |
Wikidata | Q105249149 |
Mol. formula | C11H10O2S |
CAS registry number | - |
Mol. weight | 206.2624 |
Temporary LOTUS id | LTS0231889 |
Name | (5z)-5-[(4e)-5-(methylsulfanyl)hex-4-en-2-yn-1-ylidene]furan-2-one |
Canonical SMILES | CS/C(C)=C/C#C/C=C1/C=CC(=O)O1 |
2D SMILES | CSC(C)=CC#CC=C1C=CC(=O)O1 |
IUPAC name | (5Z)-5-[(4E)-5-(methylsulfanyl)hex-4-en-2-yn-1-ylidene]-2,5-dihydrofuran-2-one |
InChI | InChI=1S/C11H10O2S/c1-9(14-2)5-3-4-6-10-7-8-11(12)13-10/h5-8H,1-2H3/b9-5+,10-6- |
InChIKey | SAUCIODDYUECKP-POQLCMLLSA-N |
Deep SMILES | could not be computed |
Murcko Framework | O1CC=CC1 |
Pathway | Superclass | Class |
Fatty acids | Fatty acyls | Fatty alcohols |
Total atom number | 24 |
Heavy atom number | 14 |
Bond count | 14 |
Number of carbons | 11 |
Minimal number of rings | 1 |
Maximal number of rings | 1 |
NP-likeness score | 1.01 |
Alogp | 2.14 |
Alogp2 | 4.59 |
Apol | 30.5319 |
Bpol | 16.0861 |
EccentricConnectivityIndexDescriptor | 217 |
FmfDescriptor | 0.3571 |
Fsp3 | 0.1818 |
FragmentComplexityDescriptor | 394.03 |
PetitjeanNumber | 0.5 |
LipinskiRuleOf5Failures | 0 |
WienerPathNumber | 378 |
Xlogp | 2.286 |
ZagrebIndex | 62 |
TopoPSA | 51.6 |