Name | 14-oxo-16-(3,4,5-trimethoxyphenyl)-4,6,13-trioxatetracyclo[7.7.0.0³,⁷.0¹¹,¹⁵]hexadeca-1,3(7),8-trien-10-yl acetate |
Wikidata | Q105249112 |
Mol. formula | C24H24O9 |
CAS registry number | - |
Mol. weight | 456.4429 |
Temporary LOTUS id | LTS0231867 |
Name | 14-oxo-16-(3,4,5-trimethoxyphenyl)-4,6,13-trioxatetracyclo[7.7.0.0³,⁷.0¹¹,¹⁵]hexadeca-1,3(7),8-trien-10-yl acetate |
Canonical SMILES | COc1cc(C2c3cc4c(cc3C(OC(C)=O)C3COC(=O)C23)OCO4)cc(OC)c1OC |
2D SMILES | COc1cc(C2c3cc4c(cc3C(OC(C)=O)C3COC(=O)C23)OCO4)cc(OC)c1OC |
IUPAC name | 14-oxo-16-(3,4,5-trimethoxyphenyl)-4,6,13-trioxatetracyclo[7.7.0.0³,⁷.0¹¹,¹⁵]hexadeca-1,3(7),8-trien-10-yl acetate |
InChI | InChI=1S/C24H24O9/c1-11(25)33-22-14-8-17-16(31-10-32-17)7-13(14)20(21-15(22)9-30-24(21)26)12-5-18(27-2)23(29-4)19(6-12)28-3/h5-8,15,20-22H,9-10H2,1-4H3 |
InChIKey | SASVNKPCTLROPQ-UHFFFAOYSA-N |
Deep SMILES | could not be computed |
Murcko Framework | O1c2cc3c(cc2OC1)C(c4ccccc4)C5COCC5C3 |
Pathway | Superclass | Class |
Shikimates and Phenylpropanoids | Lignans | Arylnaphthalene and aryltetralin lignans |
Total atom number | 57 |
Heavy atom number | 33 |
Bond count | 37 |
Number of carbons | 24 |
Minimal number of rings | 5 |
Maximal number of rings | 11 |
NP-likeness score | 1.01 |
Alogp | 2.49 |
Alogp2 | 6.2 |
Apol | 65.461 |
Bpol | 41.565 |
EccentricConnectivityIndexDescriptor | 669 |
FmfDescriptor | 0.6667 |
Fsp3 | 0.4167 |
FragmentComplexityDescriptor | 2665.09 |
PetitjeanNumber | 0.5 |
LipinskiRuleOf5Failures | 0 |
WienerPathNumber | 2741 |
Xlogp | 2.377 |
ZagrebIndex | 184 |
TopoPSA | 98.75 |