Name | 1-(2,4-dihydroxy-6-methoxyphenyl)-2-methylpropan-1-one |
Wikidata | Q104398989 |
Mol. formula | C11H14O4 |
CAS registry number | - |
Mol. weight | 210.2269 |
Temporary LOTUS id | LTS0231542 |
Name | 1-(2,4-dihydroxy-6-methoxyphenyl)-2-methylpropan-1-one |
Canonical SMILES | COc1cc(O)cc(O)c1C(=O)C(C)C |
2D SMILES | COc1cc(O)cc(O)c1C(=O)C(C)C |
IUPAC name | 1-(2,4-dihydroxy-6-methoxyphenyl)-2-methylpropan-1-one |
InChI | InChI=1S/C11H14O4/c1-6(2)11(14)10-8(13)4-7(12)5-9(10)15-3/h4-6,12-13H,1-3H3 |
InChIKey | BONNBLZTHDEOEP-UHFFFAOYSA-N |
Deep SMILES | could not be computed |
Murcko Framework | c1ccccc1 |
Pathway | Superclass | Class |
Polyketides | Phloroglucinols | Acyl phloroglucinols |
Total atom number | 29 |
Heavy atom number | 15 |
Bond count | 15 |
Number of carbons | 11 |
Minimal number of rings | 1 |
Maximal number of rings | 1 |
NP-likeness score | 1.03 |
Alogp | 2.15 |
Alogp2 | 4.61 |
Apol | 31.9031 |
Bpol | 18.1789 |
EccentricConnectivityIndexDescriptor | 155 |
FmfDescriptor | 0.4 |
Fsp3 | 0.3636 |
FragmentComplexityDescriptor | 631.04 |
PetitjeanNumber | 0.4286 |
LipinskiRuleOf5Failures | 0 |
WienerPathNumber | 344 |
Xlogp | 1.977 |
ZagrebIndex | 72 |
TopoPSA | 66.76 |