Name | 3-({6,10-dimethyl-3-methylidene-2-oxo-3ah,4h,5h,8h,9h,11ah-cyclodeca[b]furan-4-yl}oxy)-2-methylidene-3-oxopropyl 2-(hydroxymethyl)but-2-enoate |
Wikidata | Q105020207 |
Mol. formula | C24H30O7 |
CAS registry number | - |
Mol. weight | 430.4917 |
Temporary LOTUS id | LTS0230499 |
Name | 3-({6,10-dimethyl-3-methylidene-2-oxo-3ah,4h,5h,8h,9h,11ah-cyclodeca[b]furan-4-yl}oxy)-2-methylidene-3-oxopropyl 2-(hydroxymethyl)but-2-enoate |
Canonical SMILES | C=C(COC(=O)C(=CC)CO)C(=O)OC1CC(C)=CCCC(C)=CC2OC(=O)C(=C)C21 |
2D SMILES | C=C(COC(=O)C(=CC)CO)C(=O)OC1CC(C)=CCCC(C)=CC2OC(=O)C(=C)C21 |
IUPAC name | 3-({6,10-dimethyl-3-methylidene-2-oxo-2H,3H,3aH,4H,5H,8H,9H,11aH-cyclodeca[b]furan-4-yl}oxy)-2-methylidene-3-oxopropyl 2-(hydroxymethyl)but-2-enoate |
InChI | InChI=1S/C24H30O7/c1-6-18(12-25)24(28)29-13-16(4)22(26)30-19-10-14(2)8-7-9-15(3)11-20-21(19)17(5)23(27)31-20/h6,8,11,19-21,25H,4-5,7,9-10,12-13H2,1-3H3 |
InChIKey | GUJMGTHIANKKGJ-UHFFFAOYSA-N |
Deep SMILES | could not be computed |
Murcko Framework | O1CCC2CCC=CCCC=CC12 |
Pathway | Superclass | Class |
Terpenoids | Sesquiterpenoids | Germacrane sesquiterpenoids |
Total atom number | 61 |
Heavy atom number | 31 |
Bond count | 32 |
Number of carbons | 24 |
Minimal number of rings | 2 |
Maximal number of rings | 3 |
NP-likeness score | 0.96 |
Alogp | 4.06 |
Alogp2 | 16.47 |
Apol | 67.8578 |
Bpol | 41.4182 |
EccentricConnectivityIndexDescriptor | 705 |
FmfDescriptor | 0.4194 |
Fsp3 | 0.4583 |
FragmentComplexityDescriptor | 2914.07 |
PetitjeanNumber | 0.5 |
LipinskiRuleOf5Failures | 0 |
WienerPathNumber | 2790 |
Xlogp | 2.732 |
ZagrebIndex | 152 |
TopoPSA | 99.13 |