Name | Methyl-3,4-dimethoxycinnamate |
Wikidata | Q27159283 |
Mol. formula | C12H14O4 |
CAS registry number | - |
Mol. weight | 222.2376 |
Temporary LOTUS id | LTS0229463 |
Name | Methyl-3,4-dimethoxycinnamate |
Canonical SMILES | COC(=O)/C=C/c1ccc(OC)c(OC)c1 |
2D SMILES | COC(=O)C=Cc1ccc(OC)c(OC)c1 |
IUPAC name | methyl (2E)-3-(3,4-dimethoxyphenyl)prop-2-enoate |
InChI | InChI=1S/C12H14O4/c1-14-10-6-4-9(8-11(10)15-2)5-7-12(13)16-3/h4-8H,1-3H3/b7-5+ |
InChIKey | JXRYDOZRPYFBKO-FNORWQNLSA-N |
Deep SMILES | could not be computed |
Murcko Framework | c1ccccc1 |
Pathway | Superclass | Class |
Shikimates and Phenylpropanoids | Phenylpropanoids (C6-C3) | Cinnamic acids and derivatives |
Total atom number | 30 |
Heavy atom number | 16 |
Bond count | 16 |
Number of carbons | 12 |
Minimal number of rings | 1 |
Maximal number of rings | 1 |
NP-likeness score | 1.01 |
Alogp | 2.12 |
Alogp2 | 4.5 |
Apol | 33.6631 |
Bpol | 22.0109 |
EccentricConnectivityIndexDescriptor | 238 |
FmfDescriptor | 0.375 |
Fsp3 | 0.25 |
FragmentComplexityDescriptor | 660.04 |
PetitjeanNumber | 0.5 |
LipinskiRuleOf5Failures | 0 |
WienerPathNumber | 488 |
Xlogp | 1.792 |
ZagrebIndex | 72 |
TopoPSA | 44.76 |