Name | 3-isopropyl-6-methyl-7-methylidenetricyclo[4.4.0.0²,⁸]decane |
Wikidata | Q105290075 |
Mol. formula | C15H24 |
CAS registry number | - |
Mol. weight | 204.3516 |
Temporary LOTUS id | LTS0229393 |
Name | 3-isopropyl-6-methyl-7-methylidenetricyclo[4.4.0.0²,⁸]decane |
Canonical SMILES | C=C1C2CCC3C2C(C(C)C)CCC13C |
2D SMILES | C=C1C2CCC3C2C(C(C)C)CCC13C |
IUPAC name | 6-methyl-7-methylidene-3-(propan-2-yl)tricyclo[4.4.0.0²,⁸]decane |
InChI | InChI=1S/C15H24/c1-9(2)11-7-8-15(4)10(3)12-5-6-13(15)14(11)12/h9,11-14H,3,5-8H2,1-2,4H3 |
InChIKey | VOBBUADSYROGAT-UHFFFAOYSA-N |
Deep SMILES | could not be computed |
Murcko Framework | C1CC2CC3CCC2C3C1 |
Pathway | Superclass | Class |
Terpenoids | Sesquiterpenoids | Copacamphane sesquiterpenoids |
Total atom number | 39 |
Heavy atom number | 15 |
Bond count | 17 |
Number of carbons | 15 |
Minimal number of rings | 3 |
Maximal number of rings | 7 |
NP-likeness score | 1 |
Alogp | 4.22 |
Alogp2 | 17.83 |
Apol | 42.403 |
Bpol | 26.237 |
EccentricConnectivityIndexDescriptor | 155 |
FmfDescriptor | 0.6667 |
Fsp3 | 0.8667 |
FragmentComplexityDescriptor | 1471 |
PetitjeanNumber | 0.5 |
LipinskiRuleOf5Failures | 1 |
WienerPathNumber | 303 |
Xlogp | 6.346 |
ZagrebIndex | 90 |
TopoPSA | 0 |