Name | 2-isopropyl-2h-furo[3,2-g]chromene-3,7-dione |
Wikidata | Q105216779 |
Mol. formula | C14H12O4 |
CAS registry number | - |
Mol. weight | 244.2432 |
Temporary LOTUS id | LTS0229376 |
Name | 2-isopropyl-2h-furo[3,2-g]chromene-3,7-dione |
Canonical SMILES | CC(C)C1Oc2cc3oc(=O)ccc3cc2C1=O |
2D SMILES | CC(C)C1Oc2cc3oc(=O)ccc3cc2C1=O |
IUPAC name | 2-(propan-2-yl)-2H,3H,7H-furo[3,2-g]chromene-3,7-dione |
InChI | InChI=1S/C14H12O4/c1-7(2)14-13(16)9-5-8-3-4-12(15)17-10(8)6-11(9)18-14/h3-7,14H,1-2H3 |
InChIKey | PYTXVUBIYABGPG-UHFFFAOYSA-N |
Deep SMILES | could not be computed |
Murcko Framework | O1c2cc3OCCc3cc2C=CC1 |
Pathway | Superclass | Class |
Shikimates and Phenylpropanoids|Shikimates and Phenylpropanoids | Coumarins|Coumarins | Furocoumarins|Simple coumarins |
Total atom number | 30 |
Heavy atom number | 18 |
Bond count | 20 |
Number of carbons | 14 |
Minimal number of rings | 3 |
Maximal number of rings | 6 |
NP-likeness score | 1.03 |
Alogp | 3.01 |
Alogp2 | 9.08 |
Apol | 35.8495 |
Bpol | 18.8665 |
EccentricConnectivityIndexDescriptor | 270 |
FmfDescriptor | 0.7222 |
Fsp3 | 0.2857 |
FragmentComplexityDescriptor | 718.04 |
PetitjeanNumber | 0.4444 |
LipinskiRuleOf5Failures | 0 |
WienerPathNumber | 569 |
Xlogp | 3.085 |
ZagrebIndex | 100 |
TopoPSA | 56.51 |