Name | (3ar,4s,11ar)-4-hydroxy-6,10-dimethyl-3-methylidene-3ah,4h,5h,8h,9h,11ah-cyclodeca[b]furan-2-one |
Wikidata | Q105206397 |
Mol. formula | C15H20O3 |
CAS registry number | - |
Mol. weight | 248.3181 |
Temporary LOTUS id | LTS0227634 |
Name | (3ar,4s,11ar)-4-hydroxy-6,10-dimethyl-3-methylidene-3ah,4h,5h,8h,9h,11ah-cyclodeca[b]furan-2-one |
Canonical SMILES | C=C1C(=O)O[C@@H]2/C=C(\C)CC/C=C(\C)C[C@H](O)[C@@H]12 |
2D SMILES | C=C1C(=O)OC2C=C(C)CCC=C(C)CC(O)C12 |
IUPAC name | (3aR,4S,11aR)-4-hydroxy-6,10-dimethyl-3-methylidene-2H,3H,3aH,4H,5H,8H,9H,11aH-cyclodeca[b]furan-2-one |
InChI | InChI=1S/C15H20O3/c1-9-5-4-6-10(2)8-13-14(12(16)7-9)11(3)15(17)18-13/h5,8,12-14,16H,3-4,6-7H2,1-2H3/b9-5+,10-8+/t12-,13+,14+/m0/s1 |
InChIKey | PDEJECFRCJOMEN-WQURXQIUSA-N |
Deep SMILES | could not be computed |
Murcko Framework | O1CCC2CCC=CCCC=CC12 |
Pathway | Superclass | Class |
Terpenoids | Sesquiterpenoids | Germacrane sesquiterpenoids |
Total atom number | 38 |
Heavy atom number | 18 |
Bond count | 19 |
Number of carbons | 15 |
Minimal number of rings | 2 |
Maximal number of rings | 3 |
NP-likeness score | 0.98 |
Alogp | 2.79 |
Alogp2 | 7.79 |
Apol | 42.1419 |
Bpol | 24.7381 |
EccentricConnectivityIndexDescriptor | 223 |
FmfDescriptor | 0.7222 |
Fsp3 | 0.5333 |
FragmentComplexityDescriptor | 1215.03 |
PetitjeanNumber | 0.2857 |
LipinskiRuleOf5Failures | 0 |
WienerPathNumber | 545 |
Xlogp | 1.856 |
ZagrebIndex | 92 |
TopoPSA | 46.53 |