Name | Rotundic acid |
Wikidata | Q27139015 |
Mol. formula | C30H48O5 |
CAS registry number | - |
Mol. weight | 488.7003 |
Temporary LOTUS id | LTS0227359 |
Name | Rotundic acid |
Canonical SMILES | C[C@@H]1CC[C@]2(C(=O)O)CC[C@]3(C)C(=CC[C@@H]4[C@@]5(C)CC[C@H](O)[C@@](C)(CO)[C@@H]5CC[C@]43C)[C@@H]2[C@]1(C)O |
2D SMILES | CC1CCC2(C(=O)O)CCC3(C)C(=CCC4C5(C)CCC(O)C(C)(CO)C5CCC43C)C2C1(C)O |
IUPAC name | (1R,2R,4aS,6aS,6bR,8aR,9R,10S,12aR,12bR,14bS)-1,10-dihydroxy-9-(hydroxymethyl)-1,2,6a,6b,9,12a-hexamethyl-1,2,3,4,4a,5,6,6a,6b,7,8,8a,9,10,11,12,12a,12b,13,14b-icosahydropicene-4a-carboxylic acid |
InChI | InChI=1S/C30H48O5/c1-18-9-14-30(24(33)34)16-15-27(4)19(23(30)29(18,6)35)7-8-21-25(2)12-11-22(32)26(3,17-31)20(25)10-13-28(21,27)5/h7,18,20-23,31-32,35H,8-17H2,1-6H3,(H,33,34)/t18-,20-,21-,22+,23-,25+,26+,27-,28-,29-,30+/m1/s1 |
InChIKey | YLHQFGOOMKJFLP-LTFXOGOQSA-N |
Deep SMILES | could not be computed |
Murcko Framework | C1=C2C3CCCCC3CCC2C4CCC5CCCCC5C4C1 |
Pathway | Superclass | Class |
Terpenoids | Triterpenoids | Ursane and Taraxastane triterpenoids |
Total atom number | 83 |
Heavy atom number | 35 |
Bond count | 39 |
Number of carbons | 30 |
Minimal number of rings | 5 |
Maximal number of rings | 14 |
NP-likeness score | 1.36 |
Alogp | 4.23 |
Alogp2 | 17.88 |
Apol | 88.8161 |
Bpol | 53.4319 |
EccentricConnectivityIndexDescriptor | 715 |
FmfDescriptor | 0.6286 |
Fsp3 | 0.9 |
FragmentComplexityDescriptor | 6379.05 |
PetitjeanNumber | 0.5 |
LipinskiRuleOf5Failures | 1 |
WienerPathNumber | 3066 |
Xlogp | 6.075 |
ZagrebIndex | 214 |
TopoPSA | 97.99 |