Name | (2r,3s)-2-ethenyl-2-methyl-3-(3-methylbut-2-en-1-yl)oxirane |
Wikidata | Q67880127 |
Mol. formula | C10H16O |
CAS registry number | - |
Mol. weight | 152.2338 |
Temporary LOTUS id | LTS0227173 |
Name | (2r,3s)-2-ethenyl-2-methyl-3-(3-methylbut-2-en-1-yl)oxirane |
Canonical SMILES | C=C[C@@]1(C)O[C@H]1CC=C(C)C |
2D SMILES | C=CC1(C)OC1CC=C(C)C |
IUPAC name | (2R,3S)-2-ethenyl-2-methyl-3-(3-methylbut-2-en-1-yl)oxirane |
InChI | InChI=1S/C10H16O/c1-5-10(4)9(11-10)7-6-8(2)3/h5-6,9H,1,7H2,2-4H3/t9-,10+/m0/s1 |
InChIKey | DUBZPCHJCIFTKB-VHSXEESVSA-N |
Deep SMILES | could not be computed |
Murcko Framework | O1CC1 |
Pathway | Superclass | Class |
Terpenoids | Monoterpenoids | Acyclic monoterpenoids |
Total atom number | 27 |
Heavy atom number | 11 |
Bond count | 11 |
Number of carbons | 10 |
Minimal number of rings | 1 |
Maximal number of rings | 1 |
NP-likeness score | 1 |
Alogp | 2.53 |
Alogp2 | 6.43 |
Apol | 29.0707 |
Bpol | 19.4073 |
EccentricConnectivityIndexDescriptor | 117 |
FmfDescriptor | 0.2727 |
Fsp3 | 0.6 |
FragmentComplexityDescriptor | 619.01 |
PetitjeanNumber | 0.4286 |
LipinskiRuleOf5Failures | 0 |
WienerPathNumber | 174 |
Xlogp | 2.245 |
ZagrebIndex | 54 |
TopoPSA | 12.53 |