Name | 2-hydroxy-5-methylcyclopent-2-en-1-one |
Wikidata | Q105157030 |
Mol. formula | C6H8O2 |
CAS registry number | - |
Mol. weight | 112.1268 |
Temporary LOTUS id | LTS0226274 |
Name | 2-hydroxy-5-methylcyclopent-2-en-1-one |
Canonical SMILES | CC1CC=C(O)C1=O |
2D SMILES | CC1CC=C(O)C1=O |
IUPAC name | 2-hydroxy-5-methylcyclopent-2-en-1-one |
InChI | InChI=1S/C6H8O2/c1-4-2-3-5(7)6(4)8/h3-4,7H,2H2,1H3 |
InChIKey | LTMNDGSOQVSRMK-UHFFFAOYSA-N |
Deep SMILES | could not be computed |
Murcko Framework | C1=CCCC1 |
Pathway | Superclass | Class |
- | - | - |
Total atom number | 16 |
Heavy atom number | 8 |
Bond count | 8 |
Number of carbons | 6 |
Minimal number of rings | 1 |
Maximal number of rings | 1 |
NP-likeness score | 1.71 |
Alogp | 0.59 |
Alogp2 | 0.35 |
Apol | 17.4983 |
Bpol | 9.7037 |
EccentricConnectivityIndexDescriptor | 47 |
FmfDescriptor | 0.625 |
Fsp3 | 0.5 |
FragmentComplexityDescriptor | 200.02 |
PetitjeanNumber | 0.5 |
LipinskiRuleOf5Failures | 0 |
WienerPathNumber | 58 |
Xlogp | 0.878 |
ZagrebIndex | 38 |
TopoPSA | 37.3 |