Name | (1s,2s,5s)-2-methyl-5-[(1s)-1,2,2-trimethylcyclopentyl]cyclohex-3-ene-1,2-diol |
Wikidata | Q104917321 |
Mol. formula | C15H26O2 |
CAS registry number | - |
Mol. weight | 238.3663 |
Temporary LOTUS id | LTS0226171 |
Name | (1s,2s,5s)-2-methyl-5-[(1s)-1,2,2-trimethylcyclopentyl]cyclohex-3-ene-1,2-diol |
Canonical SMILES | CC1(C)CCC[C@@]1(C)[C@@H]1C=C[C@](C)(O)[C@@H](O)C1 |
2D SMILES | CC1(O)C=CC(C2(C)CCCC2(C)C)CC1O |
IUPAC name | (1S,2S,5S)-2-methyl-5-[(1S)-1,2,2-trimethylcyclopentyl]cyclohex-3-ene-1,2-diol |
InChI | InChI=1S/C15H26O2/c1-13(2)7-5-8-14(13,3)11-6-9-15(4,17)12(16)10-11/h6,9,11-12,16-17H,5,7-8,10H2,1-4H3/t11-,12+,14+,15+/m1/s1 |
InChIKey | ARHSYZHJIIRPIL-DHMWGJHJSA-N |
Deep SMILES | could not be computed |
Murcko Framework | C1=CC(CCC1)C2CCCC2 |
Pathway | Superclass | Class |
Terpenoids | Sesquiterpenoids | Cuparane sesquiterpenoids |
Total atom number | 43 |
Heavy atom number | 17 |
Bond count | 18 |
Number of carbons | 15 |
Minimal number of rings | 2 |
Maximal number of rings | 2 |
NP-likeness score | 1.38 |
Alogp | 2.59 |
Alogp2 | 6.73 |
Apol | 45.3406 |
Bpol | 28.4234 |
EccentricConnectivityIndexDescriptor | 201 |
FmfDescriptor | 0.6471 |
Fsp3 | 0.8667 |
FragmentComplexityDescriptor | 1664.02 |
PetitjeanNumber | 0.4286 |
LipinskiRuleOf5Failures | 0 |
WienerPathNumber | 467 |
Xlogp | 4.476 |
ZagrebIndex | 96 |
TopoPSA | 40.46 |