Name | Phenethyl valerate |
Wikidata | Q27159525 |
Mol. formula | C13H18O2 |
CAS registry number | - |
Mol. weight | 206.2813 |
Temporary LOTUS id | LTS0225639 |
Name | Phenethyl valerate |
Canonical SMILES | CCCCC(=O)OCCc1ccccc1 |
2D SMILES | CCCCC(=O)OCCc1ccccc1 |
IUPAC name | 2-phenylethyl pentanoate |
InChI | InChI=1S/C13H18O2/c1-2-3-9-13(14)15-11-10-12-7-5-4-6-8-12/h4-8H,2-3,9-11H2,1H3 |
InChIKey | PDGPIBIURNPBSE-UHFFFAOYSA-N |
Deep SMILES | could not be computed |
Murcko Framework | c1ccccc1 |
Pathway | Superclass | Class |
Fatty acids | Fatty esters | Wax monoesters |
Total atom number | 33 |
Heavy atom number | 15 |
Bond count | 15 |
Number of carbons | 13 |
Minimal number of rings | 1 |
Maximal number of rings | 1 |
NP-likeness score | 1.01 |
Alogp | 3.51 |
Alogp2 | 12.29 |
Apol | 36.4863 |
Bpol | 22.5517 |
EccentricConnectivityIndexDescriptor | 254 |
FmfDescriptor | 0.4 |
Fsp3 | 0.4615 |
FragmentComplexityDescriptor | 879.02 |
PetitjeanNumber | 0.4545 |
LipinskiRuleOf5Failures | 0 |
WienerPathNumber | 462 |
Xlogp | 3.5 |
ZagrebIndex | 64 |
TopoPSA | 26.3 |