Name | 10-hydroxy-2,6,10-trimethyldodeca-2,6,11-trien-4-yl acetate |
Wikidata | Q105183001 |
Mol. formula | C17H28O3 |
CAS registry number | - |
Mol. weight | 280.4031 |
Temporary LOTUS id | LTS0224827 |
Name | 10-hydroxy-2,6,10-trimethyldodeca-2,6,11-trien-4-yl acetate |
Canonical SMILES | C=CC(C)(O)CCC=C(C)CC(C=C(C)C)OC(C)=O |
2D SMILES | C=CC(C)(O)CCC=C(C)CC(C=C(C)C)OC(C)=O |
IUPAC name | 10-hydroxy-2,6,10-trimethyldodeca-2,6,11-trien-4-yl acetate |
InChI | InChI=1S/C17H28O3/c1-7-17(6,19)10-8-9-14(4)12-16(11-13(2)3)20-15(5)18/h7,9,11,16,19H,1,8,10,12H2,2-6H3 |
InChIKey | NPEPFIZZFKCFTL-UHFFFAOYSA-N |
Deep SMILES | could not be computed |
Murcko Framework | not applicable |
Pathway | Superclass | Class |
Terpenoids | Sesquiterpenoids | Farnesane sesquiterpenoids |
Total atom number | 48 |
Heavy atom number | 20 |
Bond count | 19 |
Number of carbons | 17 |
Minimal number of rings | 0 |
Maximal number of rings | 0 |
NP-likeness score | 1.33 |
Alogp | 3.84 |
Alogp2 | 14.74 |
Apol | 50.9962 |
Bpol | 33.4838 |
EccentricConnectivityIndexDescriptor | 332 |
FmfDescriptor | 0 |
Fsp3 | 0.5882 |
FragmentComplexityDescriptor | 1829.03 |
PetitjeanNumber | 0.4545 |
LipinskiRuleOf5Failures | 0 |
WienerPathNumber | 963 |
Xlogp | 3.211 |
ZagrebIndex | 88 |
TopoPSA | 46.53 |