Name | 7-ethenyl-1-(hydroxymethyl)-1,4a,7-trimethyl-3,4,4b,5,6,8,10,10a-octahydro-2h-phenanthren-2-ol |
Wikidata | Q105178686 |
Mol. formula | C20H32O2 |
CAS registry number | - |
Mol. weight | 304.4676 |
Temporary LOTUS id | LTS0224416 |
Name | 7-ethenyl-1-(hydroxymethyl)-1,4a,7-trimethyl-3,4,4b,5,6,8,10,10a-octahydro-2h-phenanthren-2-ol |
Canonical SMILES | C=CC1(C)CCC2C(=CCC3C(C)(CO)C(O)CCC23C)C1 |
2D SMILES | C=CC1(C)CCC2C(=CCC3C(C)(CO)C(O)CCC23C)C1 |
IUPAC name | 7-ethenyl-1-(hydroxymethyl)-1,4a,7-trimethyl-1,2,3,4,4a,4b,5,6,7,8,10,10a-dodecahydrophenanthren-2-ol |
InChI | InChI=1S/C20H32O2/c1-5-18(2)10-8-15-14(12-18)6-7-16-19(15,3)11-9-17(22)20(16,4)13-21/h5-6,15-17,21-22H,1,7-13H2,2-4H3 |
InChIKey | NFUDIHFRVVFXHZ-UHFFFAOYSA-N |
Deep SMILES | could not be computed |
Murcko Framework | C1=C2CCCCC2C3CCCCC3C1 |
Pathway | Superclass | Class |
Terpenoids | Diterpenoids | Pimarane and Isopimarane diterpenoids |
Total atom number | 54 |
Heavy atom number | 22 |
Bond count | 24 |
Number of carbons | 20 |
Minimal number of rings | 3 |
Maximal number of rings | 6 |
NP-likeness score | 1 |
Alogp | 3.57 |
Alogp2 | 12.75 |
Apol | 58.1414 |
Bpol | 34.9826 |
EccentricConnectivityIndexDescriptor | 352 |
FmfDescriptor | 0.6364 |
Fsp3 | 0.8 |
FragmentComplexityDescriptor | 2674.02 |
PetitjeanNumber | 0.5 |
LipinskiRuleOf5Failures | 1 |
WienerPathNumber | 924 |
Xlogp | 5.6 |
ZagrebIndex | 126 |
TopoPSA | 40.46 |