Name | (1s,2r,5s,7s)-2,6,6,8-tetramethyltricyclo[5.2.2.0¹,⁵]undec-8-ene |
Wikidata | Q105247062 |
Mol. formula | C15H24 |
CAS registry number | - |
Mol. weight | 204.3516 |
Temporary LOTUS id | LTS0224374 |
Name | (1s,2r,5s,7s)-2,6,6,8-tetramethyltricyclo[5.2.2.0¹,⁵]undec-8-ene |
Canonical SMILES | CC1=C[C@@]23CC[C@@H]1C(C)(C)[C@@H]2CC[C@H]3C |
2D SMILES | CC1=CC23CCC1C(C)(C)C2CCC3C |
IUPAC name | (1S,2R,5S,7S)-2,6,6,8-tetramethyltricyclo[5.2.2.0¹,⁵]undec-8-ene |
InChI | InChI=1S/C15H24/c1-10-9-15-8-7-12(10)14(3,4)13(15)6-5-11(15)2/h9,11-13H,5-8H2,1-4H3/t11-,12+,13+,15-/m1/s1 |
InChIKey | RXIZECQHNGXURN-UKTARXLSSA-N |
Deep SMILES | could not be computed |
Murcko Framework | C1=CC23CCCC3CC1CC2 |
Pathway | Superclass | Class |
Terpenoids | Sesquiterpenoids | Patchoulane sesquiterpenoids |
Total atom number | 39 |
Heavy atom number | 15 |
Bond count | 17 |
Number of carbons | 15 |
Minimal number of rings | 3 |
Maximal number of rings | 6 |
NP-likeness score | 1 |
Alogp | 4.12 |
Alogp2 | 17 |
Apol | 42.403 |
Bpol | 26.237 |
EccentricConnectivityIndexDescriptor | 143 |
FmfDescriptor | 0.7333 |
Fsp3 | 0.8667 |
FragmentComplexityDescriptor | 1471 |
PetitjeanNumber | 0.4 |
LipinskiRuleOf5Failures | 1 |
WienerPathNumber | 286 |
Xlogp | 6.399 |
ZagrebIndex | 92 |
TopoPSA | 0 |