Name | 10-hydroxy-2,11-dimethyl-7-methylidene-6,12-dioxo-5,14-dioxatricyclo[9.2.1.0⁴,⁸]tetradeca-1(13),2-dien-9-yl 2-methylbut-2-enoate |
Wikidata | Q105007049 |
Mol. formula | C20H22O7 |
CAS registry number | - |
Mol. weight | 374.3852 |
Temporary LOTUS id | LTS0223862 |
Name | 10-hydroxy-2,11-dimethyl-7-methylidene-6,12-dioxo-5,14-dioxatricyclo[9.2.1.0⁴,⁸]tetradeca-1(13),2-dien-9-yl 2-methylbut-2-enoate |
Canonical SMILES | C=C1C(=O)OC2C=C(C)C3=CC(=O)C(C)(O3)C(O)C(OC(=O)C(C)=CC)C12 |
2D SMILES | C=C1C(=O)OC2C=C(C)C3=CC(=O)C(C)(O3)C(O)C(OC(=O)C(C)=CC)C12 |
IUPAC name | 10-hydroxy-2,11-dimethyl-7-methylidene-6,12-dioxo-5,14-dioxatricyclo[9.2.1.0⁴,⁸]tetradeca-1(13),2-dien-9-yl 2-methylbut-2-enoate |
InChI | InChI=1S/C20H22O7/c1-6-9(2)18(23)26-16-15-11(4)19(24)25-13(15)7-10(3)12-8-14(21)20(5,27-12)17(16)22/h6-8,13,15-17,22H,4H2,1-3,5H3 |
InChIKey | GDZUNXYZSHAMFN-UHFFFAOYSA-N |
Deep SMILES | could not be computed |
Murcko Framework | O1C=2C=CC3OCCC3CCC1CC2 |
Pathway | Superclass | Class |
Terpenoids | Sesquiterpenoids | Germacrane sesquiterpenoids |
Total atom number | 49 |
Heavy atom number | 27 |
Bond count | 29 |
Number of carbons | 20 |
Minimal number of rings | 3 |
Maximal number of rings | 6 |
NP-likeness score | 1.08 |
Alogp | 1.82 |
Alogp2 | 3.3 |
Apol | 55.4834 |
Bpol | 32.6726 |
EccentricConnectivityIndexDescriptor | 442 |
FmfDescriptor | 0.5185 |
Fsp3 | 0.45 |
FragmentComplexityDescriptor | 1899.07 |
PetitjeanNumber | 0.5 |
LipinskiRuleOf5Failures | 0 |
WienerPathNumber | 1559 |
Xlogp | 1.107 |
ZagrebIndex | 148 |
TopoPSA | 99.13 |