Name | (2e)-n-{4-[(4-hydroxyphenyl)formamido]butyl}-3-phenylprop-2-enimidic acid |
Wikidata | Q105214993 |
Mol. formula | C20H22N2O3 |
CAS registry number | - |
Mol. weight | 338.401 |
Temporary LOTUS id | LTS0223115 |
Name | (2e)-n-{4-[(4-hydroxyphenyl)formamido]butyl}-3-phenylprop-2-enimidic acid |
Canonical SMILES | O=C(NCCCCN=C(O)/C=C/c1ccccc1)c1ccc(O)cc1 |
2D SMILES | O=C(NCCCCN=C(O)C=Cc1ccccc1)c1ccc(O)cc1 |
IUPAC name | (2E)-N-{4-[(4-hydroxyphenyl)formamido]butyl}-3-phenylprop-2-enimidic acid |
InChI | InChI=1S/C20H22N2O3/c23-18-11-9-17(10-12-18)20(25)22-15-5-4-14-21-19(24)13-8-16-6-2-1-3-7-16/h1-3,6-13,23H,4-5,14-15H2,(H,21,24)(H,22,25)/b13-8+ |
InChIKey | PUAOAVBHSGXXDN-MDWZMJQESA-N |
Deep SMILES | could not be computed |
Murcko Framework | N(=CC=Cc1ccccc1)CCCCNCc2ccccc2 |
Pathway | Superclass | Class |
Alkaloids|Shikimates and Phenylpropanoids | Ornithine alkaloids| | Polyamines| |
Total atom number | 47 |
Heavy atom number | 25 |
Bond count | 26 |
Number of carbons | 20 |
Minimal number of rings | 2 |
Maximal number of rings | 2 |
NP-likeness score | 0.94 |
Alogp | 3.05 |
Alogp2 | 9.3 |
Apol | 54.4754 |
Bpol | 26.9886 |
EccentricConnectivityIndexDescriptor | 730 |
FmfDescriptor | 0.88 |
Fsp3 | 0.2 |
FragmentComplexityDescriptor | 1704.05 |
PetitjeanNumber | 0.5 |
LipinskiRuleOf5Failures | 0 |
WienerPathNumber | 2088 |
Xlogp | 3.644 |
ZagrebIndex | 116 |
TopoPSA | 81.92 |