Name | 15-(3-hydroxy-6-methylhept-5-en-2-yl)-7-(hydroxymethyl)-7,12,16-trimethylpentacyclo[9.7.0.0¹,³.0³,⁸.0¹²,¹⁶]octadecane-6,14-diol |
Wikidata | Q105249546 |
Mol. formula | C30H50O4 |
CAS registry number | - |
Mol. weight | 474.7167 |
Temporary LOTUS id | LTS0221392 |
Name | 15-(3-hydroxy-6-methylhept-5-en-2-yl)-7-(hydroxymethyl)-7,12,16-trimethylpentacyclo[9.7.0.0¹,³.0³,⁸.0¹²,¹⁶]octadecane-6,14-diol |
Canonical SMILES | CC(C)=CCC(O)C(C)C1C(O)CC2(C)C3CCC4C(C)(CO)C(O)CCC45CC35CCC12C |
2D SMILES | CC(C)=CCC(O)C(C)C1C(O)CC2(C)C3CCC4C(C)(CO)C(O)CCC45CC35CCC12C |
IUPAC name | 15-(3-hydroxy-6-methylhept-5-en-2-yl)-7-(hydroxymethyl)-7,12,16-trimethylpentacyclo[9.7.0.0¹,³.0³,⁸.0¹²,¹⁶]octadecane-6,14-diol |
InChI | InChI=1S/C30H50O4/c1-18(2)7-8-20(32)19(3)25-21(33)15-28(6)23-10-9-22-26(4,17-31)24(34)11-12-29(22)16-30(23,29)14-13-27(25,28)5/h7,19-25,31-34H,8-17H2,1-6H3 |
InChIKey | SBMFUYVWTXYRCJ-UHFFFAOYSA-N |
Deep SMILES | could not be computed |
Murcko Framework | C1CCC23CC43CCC5CCCC5C4CCC2C1 |
Pathway | Superclass | Class |
Terpenoids | Triterpenoids | Cycloartane triterpenoids |
Total atom number | 84 |
Heavy atom number | 34 |
Bond count | 38 |
Number of carbons | 30 |
Minimal number of rings | 5 |
Maximal number of rings | 17 |
NP-likeness score | 1 |
Alogp | 4.12 |
Alogp2 | 17.01 |
Apol | 89.3476 |
Bpol | 54.6603 |
EccentricConnectivityIndexDescriptor | 831 |
FmfDescriptor | 0.5294 |
Fsp3 | 0.9333 |
FragmentComplexityDescriptor | 6622.04 |
PetitjeanNumber | 0.4667 |
LipinskiRuleOf5Failures | 1 |
WienerPathNumber | 3142 |
Xlogp | 7.048 |
ZagrebIndex | 206 |
TopoPSA | 80.92 |