Name | (2r,3s,4s,5r,6s)-2-(hydroxymethyl)-6-{4-[(1z)-3-hydroxyprop-1-en-1-yl]-2,6-dimethoxyphenoxy}oxane-3,4,5-triol |
Wikidata | Q105222915 |
Mol. formula | C17H24O9 |
CAS registry number | - |
Mol. weight | 372.3677 |
Temporary LOTUS id | LTS0220932 |
Name | (2r,3s,4s,5r,6s)-2-(hydroxymethyl)-6-{4-[(1z)-3-hydroxyprop-1-en-1-yl]-2,6-dimethoxyphenoxy}oxane-3,4,5-triol |
Canonical SMILES | COc1cc(/C=C\CO)cc(OC)c1O[C@@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O |
2D SMILES | COc1cc(C=CCO)cc(OC)c1OC1OC(CO)C(O)C(O)C1O |
IUPAC name | (2R,3S,4S,5R,6S)-2-(hydroxymethyl)-6-{4-[(1Z)-3-hydroxyprop-1-en-1-yl]-2,6-dimethoxyphenoxy}oxane-3,4,5-triol |
InChI | InChI=1S/C17H24O9/c1-23-10-6-9(4-3-5-18)7-11(24-2)16(10)26-17-15(22)14(21)13(20)12(8-19)25-17/h3-4,6-7,12-15,17-22H,5,8H2,1-2H3/b4-3-/t12-,13-,14+,15-,17+/m1/s1 |
InChIKey | QJVXKWHHAMZTBY-CZZVJJMOSA-N |
Deep SMILES | could not be computed |
Murcko Framework | c1ccccc1 |
Pathway | Superclass | Class |
Shikimates and Phenylpropanoids|Terpenoids | Phenylpropanoids (C6-C3)|Monoterpenoids | Cinnamic acids and derivatives|Menthane monoterpenoids |
Total atom number | 50 |
Heavy atom number | 26 |
Bond count | 27 |
Number of carbons | 17 |
Minimal number of rings | 2 |
Maximal number of rings | 2 |
NP-likeness score | 1 |
Alogp | -0.51 |
Alogp2 | 0.26 |
Apol | 53.141 |
Bpol | 33.901 |
EccentricConnectivityIndexDescriptor | 519 |
FmfDescriptor | 0.5 |
Fsp3 | 0.5294 |
FragmentComplexityDescriptor | 1951.09 |
PetitjeanNumber | 0.4615 |
LipinskiRuleOf5Failures | 0 |
WienerPathNumber | 1669 |
Xlogp | -0.337 |
ZagrebIndex | 128 |
TopoPSA | 138.07 |