Name | {3-ethenyl-3,4a,7,10a-tetramethyl-octahydro-1h-naphtho[2,1-b]pyran-7-yl}methanol |
Wikidata | Q105169019 |
Mol. formula | C20H34O2 |
CAS registry number | - |
Mol. weight | 306.4835 |
Temporary LOTUS id | LTS0219124 |
Name | {3-ethenyl-3,4a,7,10a-tetramethyl-octahydro-1h-naphtho[2,1-b]pyran-7-yl}methanol |
Canonical SMILES | C=CC1(C)CCC2C(C)(CCC3C(C)(CO)CCCC32C)O1 |
2D SMILES | C=CC1(C)CCC2C(C)(CCC3C(C)(CO)CCCC32C)O1 |
IUPAC name | {3-ethenyl-3,4a,7,10a-tetramethyl-dodecahydro-1H-naphtho[2,1-b]pyran-7-yl}methanol |
InChI | InChI=1S/C20H34O2/c1-6-18(3)12-8-16-19(4)11-7-10-17(2,14-21)15(19)9-13-20(16,5)22-18/h6,15-16,21H,1,7-14H2,2-5H3 |
InChIKey | MONXCRDSDZQGGT-UHFFFAOYSA-N |
Deep SMILES | could not be computed |
Murcko Framework | O1CCCC2C1CCC3CCCCC32 |
Pathway | Superclass | Class |
Terpenoids | Diterpenoids | Labdane diterpenoids |
Total atom number | 56 |
Heavy atom number | 22 |
Bond count | 24 |
Number of carbons | 20 |
Minimal number of rings | 3 |
Maximal number of rings | 6 |
NP-likeness score | 1.16 |
Alogp | 3.95 |
Alogp2 | 15.57 |
Apol | 59.475 |
Bpol | 39.085 |
EccentricConnectivityIndexDescriptor | 346 |
FmfDescriptor | 0.6364 |
Fsp3 | 0.9 |
FragmentComplexityDescriptor | 2902.02 |
PetitjeanNumber | 0.5 |
LipinskiRuleOf5Failures | 0 |
WienerPathNumber | 901 |
Xlogp | 4.82 |
ZagrebIndex | 128 |
TopoPSA | 29.46 |