Name | (3ar,11as)-6-methyl-3-methylidene-2-oxo-3ah,4h,7h,8h,11h,11ah-cyclodeca[b]furan-10-carboxylic acid |
Wikidata | Q105382844 |
Mol. formula | C15H18O4 |
CAS registry number | - |
Mol. weight | 262.3016 |
Temporary LOTUS id | LTS0218217 |
Name | (3ar,11as)-6-methyl-3-methylidene-2-oxo-3ah,4h,7h,8h,11h,11ah-cyclodeca[b]furan-10-carboxylic acid |
Canonical SMILES | C=C1C(=O)O[C@H]2C/C(C(=O)O)=C\CC/C(C)=C/C[C@H]12 |
2D SMILES | C=C1C(=O)OC2CC(C(=O)O)=CCCC(C)=CCC12 |
IUPAC name | (3aR,11aS)-6-methyl-3-methylidene-2-oxo-2H,3H,3aH,4H,7H,8H,11H,11aH-cyclodeca[b]furan-10-carboxylic acid |
InChI | InChI=1S/C15H18O4/c1-9-4-3-5-11(14(16)17)8-13-12(7-6-9)10(2)15(18)19-13/h5-6,12-13H,2-4,7-8H2,1H3,(H,16,17)/b9-6+,11-5+/t12-,13+/m1/s1 |
InChIKey | ZTCKLMZDVQRERE-OLRSHLRNSA-N |
Deep SMILES | could not be computed |
Murcko Framework | O1CCC2CC=CCCC=CCC12 |
Pathway | Superclass | Class |
Terpenoids | Sesquiterpenoids | Germacrane sesquiterpenoids |
Total atom number | 37 |
Heavy atom number | 19 |
Bond count | 20 |
Number of carbons | 15 |
Minimal number of rings | 2 |
Maximal number of rings | 3 |
NP-likeness score | 1.52 |
Alogp | 3.01 |
Alogp2 | 9.03 |
Apol | 41.6103 |
Bpol | 23.5097 |
EccentricConnectivityIndexDescriptor | 242 |
FmfDescriptor | 0.6842 |
Fsp3 | 0.4667 |
FragmentComplexityDescriptor | 1102.04 |
PetitjeanNumber | 0.2857 |
LipinskiRuleOf5Failures | 0 |
WienerPathNumber | 650 |
Xlogp | 2.009 |
ZagrebIndex | 96 |
TopoPSA | 63.6 |