Name | 2,15-dioxapentacyclo[22.2.2.1³,⁷.1¹⁰,¹⁴.0¹⁶,²¹]triaconta-1(26),3(30),4,6,10(29),11,13,16,18,20,24,27-dodecaene-4,17,18-triol |
Wikidata | Q104391823 |
Mol. formula | C28H24O5 |
CAS registry number | - |
Mol. weight | 440.4882 |
Temporary LOTUS id | LTS0218132 |
Name | 2,15-dioxapentacyclo[22.2.2.1³,⁷.1¹⁰,¹⁴.0¹⁶,²¹]triaconta-1(26),3(30),4,6,10(29),11,13,16,18,20,24,27-dodecaene-4,17,18-triol |
Canonical SMILES | Oc1ccc2cc1Oc1ccc(cc1)CCc1ccc(O)c(O)c1Oc1cccc(c1)CC2 |
2D SMILES | Oc1ccc2cc1Oc1ccc(cc1)CCc1ccc(O)c(O)c1Oc1cccc(c1)CC2 |
IUPAC name | 2,15-dioxapentacyclo[22.2.2.1³,⁷.1¹⁰,¹⁴.0¹⁶,²¹]triaconta-1(26),3(30),4,6,10(29),11,13,16,18,20,24,27-dodecaene-4,17,18-triol |
InChI | InChI=1S/C28H24O5/c29-24-14-9-20-5-4-19-2-1-3-23(16-19)33-28-21(11-15-25(30)27(28)31)10-6-18-7-12-22(13-8-18)32-26(24)17-20/h1-3,7-9,11-17,29-31H,4-6,10H2 |
InChIKey | BVVNNKLMNVFVGS-UHFFFAOYSA-N |
Deep SMILES | could not be computed |
Murcko Framework | O1c2ccc(cc2)CCc3ccccc3Oc4cccc(c4)CCc5cccc1c5 |
Pathway | Superclass | Class |
Shikimates and Phenylpropanoids | Diarylheptanoids | Diarylether type diarylheptanoids |
Total atom number | 57 |
Heavy atom number | 33 |
Bond count | 37 |
Number of carbons | 28 |
Minimal number of rings | 5 |
Maximal number of rings | 10 |
NP-likeness score | 1 |
Alogp | 7.18 |
Alogp2 | 51.55 |
Apol | 69.293 |
Bpol | 30.069 |
EccentricConnectivityIndexDescriptor | 783 |
FmfDescriptor | 0.9091 |
Fsp3 | 0.1429 |
FragmentComplexityDescriptor | 2665.05 |
PetitjeanNumber | 0.3571 |
LipinskiRuleOf5Failures | 1 |
WienerPathNumber | 3000 |
Xlogp | 6.386 |
ZagrebIndex | 178 |
TopoPSA | 79.15 |