Name | 1-{2,3-dimethyltricyclo[2.2.1.0²,⁶]heptan-3-yl}-4-methylpentane-2,3,4-triol |
Wikidata | Q105000651 |
Mol. formula | C15H26O3 |
CAS registry number | - |
Mol. weight | 254.3657 |
Temporary LOTUS id | LTS0216947 |
Name | 1-{2,3-dimethyltricyclo[2.2.1.0²,⁶]heptan-3-yl}-4-methylpentane-2,3,4-triol |
Canonical SMILES | CC(C)(O)C(O)C(O)CC1(C)C2CC3C(C2)C31C |
2D SMILES | CC(C)(O)C(O)C(O)CC1(C)C2CC3C(C2)C31C |
IUPAC name | 1-{2,3-dimethyltricyclo[2.2.1.0²,⁶]heptan-3-yl}-4-methylpentane-2,3,4-triol |
InChI | InChI=1S/C15H26O3/c1-13(2,18)12(17)11(16)7-14(3)8-5-9-10(6-8)15(9,14)4/h8-12,16-18H,5-7H2,1-4H3 |
InChIKey | FSIJVKIIIQJXQX-UHFFFAOYSA-N |
Deep SMILES | could not be computed |
Murcko Framework | C1C2CC3C1C3C2 |
Pathway | Superclass | Class |
Terpenoids | Sesquiterpenoids | Santalane sesquiterpenoids |
Total atom number | 44 |
Heavy atom number | 18 |
Bond count | 20 |
Number of carbons | 15 |
Minimal number of rings | 3 |
Maximal number of rings | 7 |
NP-likeness score | 1.36 |
Alogp | 1.09 |
Alogp2 | 1.18 |
Apol | 46.1426 |
Bpol | 28.4234 |
EccentricConnectivityIndexDescriptor | 236 |
FmfDescriptor | 0.3889 |
Fsp3 | 1 |
FragmentComplexityDescriptor | 1810.03 |
PetitjeanNumber | 0.4286 |
LipinskiRuleOf5Failures | 0 |
WienerPathNumber | 560 |
Xlogp | 3.116 |
ZagrebIndex | 112 |
TopoPSA | 60.69 |