Name | 4,8,11,11-tetramethylbicyclo[8.1.0]undeca-4,8-dien-2-yl 2-methylbut-2-enoate |
Wikidata | Q105166953 |
Mol. formula | C20H30O2 |
CAS registry number | - |
Mol. weight | 302.4518 |
Temporary LOTUS id | LTS0216862 |
Name | 4,8,11,11-tetramethylbicyclo[8.1.0]undeca-4,8-dien-2-yl 2-methylbut-2-enoate |
Canonical SMILES | CC=C(C)C(=O)OC1CC(C)=CCCC(C)=CC2C1C2(C)C |
2D SMILES | CC=C(C)C(=O)OC1CC(C)=CCCC(C)=CC2C1C2(C)C |
IUPAC name | 4,8,11,11-tetramethylbicyclo[8.1.0]undeca-4,8-dien-2-yl 2-methylbut-2-enoate |
InChI | InChI=1S/C20H30O2/c1-7-15(4)19(21)22-17-12-14(3)10-8-9-13(2)11-16-18(17)20(16,5)6/h7,10-11,16-18H,8-9,12H2,1-6H3 |
InChIKey | MLQMIURMODQIOF-UHFFFAOYSA-N |
Deep SMILES | could not be computed |
Murcko Framework | C1=CCCC2CC2C=CCC1 |
Pathway | Superclass | Class |
Terpenoids | Sesquiterpenoids | Bicyclogermacrane sesquiterpenoids |
Total atom number | 52 |
Heavy atom number | 22 |
Bond count | 23 |
Number of carbons | 20 |
Minimal number of rings | 2 |
Maximal number of rings | 3 |
NP-likeness score | 0.98 |
Alogp | 5.46 |
Alogp2 | 29.76 |
Apol | 56.8078 |
Bpol | 35.6702 |
EccentricConnectivityIndexDescriptor | 348 |
FmfDescriptor | 0.5 |
Fsp3 | 0.65 |
FragmentComplexityDescriptor | 2347.02 |
PetitjeanNumber | 0.5 |
LipinskiRuleOf5Failures | 1 |
WienerPathNumber | 1009 |
Xlogp | 5.44 |
ZagrebIndex | 114 |
TopoPSA | 26.3 |