Name | 18-ethylidene-2-methylidene-4,14-diazapentacyclo[12.3.1.0³,¹¹.0⁵,¹⁰.0¹¹,¹⁶]octadeca-3,5,7,9-tetraene |
Wikidata | Q105235437 |
Mol. formula | C19H20N2 |
CAS registry number | - |
Mol. weight | 276.3762 |
Temporary LOTUS id | LTS0216751 |
Name | 18-ethylidene-2-methylidene-4,14-diazapentacyclo[12.3.1.0³,¹¹.0⁵,¹⁰.0¹¹,¹⁶]octadeca-3,5,7,9-tetraene |
Canonical SMILES | C=C1C2=Nc3ccccc3C23CCN2CC3CC1C2=CC |
2D SMILES | C=C1C2=Nc3ccccc3C23CCN2CC3CC1C2=CC |
IUPAC name | 18-ethylidene-2-methylidene-4,14-diazapentacyclo[12.3.1.0³,¹¹.0⁵,¹⁰.0¹¹,¹⁶]octadeca-3,5,7,9-tetraene |
InChI | InChI=1S/C19H20N2/c1-3-17-14-10-13-11-21(17)9-8-19(13)15-6-4-5-7-16(15)20-18(19)12(14)2/h3-7,13-14H,2,8-11H2,1H3 |
InChIKey | RFJDTFHDUVLZOH-UHFFFAOYSA-N |
Deep SMILES | could not be computed |
Murcko Framework | N=1c2ccccc2C34C1CC5CN(CC3)CC4C5 |
Pathway | Superclass | Class |
Terpenoids | Diterpenoids | Valparane diterpenoids |
Total atom number | 41 |
Heavy atom number | 21 |
Bond count | 25 |
Number of carbons | 19 |
Minimal number of rings | 5 |
Maximal number of rings | 18 |
NP-likeness score | 1.04 |
Alogp | 3.03 |
Alogp2 | 9.2 |
Apol | 48.9759 |
Bpol | 25.1641 |
EccentricConnectivityIndexDescriptor | 328 |
FmfDescriptor | 0.8571 |
Fsp3 | 0.4211 |
FragmentComplexityDescriptor | 1605.02 |
PetitjeanNumber | 0.4444 |
LipinskiRuleOf5Failures | 0 |
WienerPathNumber | 741 |
Xlogp | 3.075 |
ZagrebIndex | 130 |
TopoPSA | 15.6 |