Name | (1s,10s)-5-hydroxy-4,11,12-trimethoxy-17-methyl-17-azatetracyclo[8.4.3.0¹,¹⁰.0²,⁷]heptadeca-2,4,6,11-tetraen-13-one |
Wikidata | Q105033544 |
Mol. formula | C20H25NO5 |
CAS registry number | - |
Mol. weight | 359.417 |
Temporary LOTUS id | LTS0214811 |
Name | (1s,10s)-5-hydroxy-4,11,12-trimethoxy-17-methyl-17-azatetracyclo[8.4.3.0¹,¹⁰.0²,⁷]heptadeca-2,4,6,11-tetraen-13-one |
Canonical SMILES | COC1=C(OC)[C@]23CCc4cc(O)c(OC)cc4[C@]2(CCN3C)CC1=O |
2D SMILES | COC1=C(OC)C23CCc4cc(O)c(OC)cc4C2(CCN3C)CC1=O |
IUPAC name | (1S,10S)-5-hydroxy-4,11,12-trimethoxy-17-methyl-17-azatetracyclo[8.4.3.0¹,¹⁰.0²,⁷]heptadeca-2,4,6,11-tetraen-13-one |
InChI | InChI=1S/C20H25NO5/c1-21-8-7-19-11-15(23)17(25-3)18(26-4)20(19,21)6-5-12-9-14(22)16(24-2)10-13(12)19/h9-10,22H,5-8,11H2,1-4H3/t19-,20+/m0/s1 |
InChIKey | HTOHHJTUVLJPIE-VQTJNVASSA-N |
Deep SMILES | could not be computed |
Murcko Framework | c1ccc2c(c1)CCC34C=CCCC24CCN3 |
Pathway | Superclass | Class |
Alkaloids | Tyrosine alkaloids | Hasubanan alkaloids |
Total atom number | 51 |
Heavy atom number | 26 |
Bond count | 29 |
Number of carbons | 20 |
Minimal number of rings | 4 |
Maximal number of rings | 10 |
NP-likeness score | 1.05 |
Alogp | 1.05 |
Alogp2 | 1.1 |
Apol | 56.9798 |
Bpol | 36.0162 |
EccentricConnectivityIndexDescriptor | 422 |
FmfDescriptor | 0.6538 |
Fsp3 | 0.55 |
FragmentComplexityDescriptor | 2266.06 |
PetitjeanNumber | 0.5 |
LipinskiRuleOf5Failures | 0 |
WienerPathNumber | 1347 |
Xlogp | 0.978 |
ZagrebIndex | 150 |
TopoPSA | 68.23 |