Name | (1r,2r,9r,10s)-9-hydroxy-1,5,9-trimethyl-3,14-dioxatricyclo[8.4.0.0²,⁶]tetradec-5-ene-4,13-dione |
Wikidata | Q105234308 |
Mol. formula | C15H20O5 |
CAS registry number | - |
Mol. weight | 280.3169 |
Temporary LOTUS id | LTS0214478 |
Name | (1r,2r,9r,10s)-9-hydroxy-1,5,9-trimethyl-3,14-dioxatricyclo[8.4.0.0²,⁶]tetradec-5-ene-4,13-dione |
Canonical SMILES | CC1=C2CC[C@@](C)(O)[C@@H]3CCC(=O)O[C@@]3(C)[C@@H]2OC1=O |
2D SMILES | CC1=C2CCC(C)(O)C3CCC(=O)OC3(C)C2OC1=O |
IUPAC name | (1R,2R,9R,10S)-9-hydroxy-1,5,9-trimethyl-3,14-dioxatricyclo[8.4.0.0²,⁶]tetradec-5-ene-4,13-dione |
InChI | InChI=1S/C15H20O5/c1-8-9-6-7-14(2,18)10-4-5-11(16)20-15(10,3)12(9)19-13(8)17/h10,12,18H,4-7H2,1-3H3/t10-,12+,14+,15+/m0/s1 |
InChIKey | RDLLMKZWCBKKMZ-QMGNLALYSA-N |
Deep SMILES | could not be computed |
Murcko Framework | O1CC=C2CCCC3CCCOC3C12 |
Pathway | Superclass | Class |
Terpenoids | Sesquiterpenoids | Guaiane sesquiterpenoids |
Total atom number | 40 |
Heavy atom number | 20 |
Bond count | 22 |
Number of carbons | 15 |
Minimal number of rings | 3 |
Maximal number of rings | 6 |
NP-likeness score | 1.41 |
Alogp | 1.47 |
Alogp2 | 2.17 |
Apol | 43.7459 |
Bpol | 27.6121 |
EccentricConnectivityIndexDescriptor | 246 |
FmfDescriptor | 0.7 |
Fsp3 | 0.7333 |
FragmentComplexityDescriptor | 1384.05 |
PetitjeanNumber | 0.4286 |
LipinskiRuleOf5Failures | 0 |
WienerPathNumber | 659 |
Xlogp | 0.861 |
ZagrebIndex | 116 |
TopoPSA | 72.83 |