Name | 3,6,9a-trimethyl-4h,5h,6h,6ah,7h,8h,9bh-azuleno[4,5-b]furan-2,9-dione |
Wikidata | Q105177937 |
Mol. formula | C15H20O3 |
CAS registry number | - |
Mol. weight | 248.3181 |
Temporary LOTUS id | LTS0213932 |
Name | 3,6,9a-trimethyl-4h,5h,6h,6ah,7h,8h,9bh-azuleno[4,5-b]furan-2,9-dione |
Canonical SMILES | CC1=C2CCC(C)C3CCC(=O)C3(C)C2OC1=O |
2D SMILES | CC1=C2CCC(C)C3CCC(=O)C3(C)C2OC1=O |
IUPAC name | 3,6,9a-trimethyl-2H,4H,5H,6H,6aH,7H,8H,9H,9aH,9bH-azuleno[4,5-b]furan-2,9-dione |
InChI | InChI=1S/C15H20O3/c1-8-4-5-10-9(2)14(17)18-13(10)15(3)11(8)6-7-12(15)16/h8,11,13H,4-7H2,1-3H3 |
InChIKey | NEHXPIGRYFZMOE-UHFFFAOYSA-N |
Deep SMILES | could not be computed |
Murcko Framework | O1CC=C2CCCC3CCCC3C12 |
Pathway | Superclass | Class |
Terpenoids | Sesquiterpenoids | Pseudoguaiane sesquiterpenoids |
Total atom number | 38 |
Heavy atom number | 18 |
Bond count | 20 |
Number of carbons | 15 |
Minimal number of rings | 3 |
Maximal number of rings | 6 |
NP-likeness score | 1 |
Alogp | 2.76 |
Alogp2 | 7.63 |
Apol | 42.1419 |
Bpol | 25.6961 |
EccentricConnectivityIndexDescriptor | 206 |
FmfDescriptor | 0.7222 |
Fsp3 | 0.7333 |
FragmentComplexityDescriptor | 1294.03 |
PetitjeanNumber | 0.4286 |
LipinskiRuleOf5Failures | 0 |
WienerPathNumber | 492 |
Xlogp | 1.795 |
ZagrebIndex | 104 |
TopoPSA | 43.37 |