Temporary LOTUS id | LTS0212965 |
Name | Acid, folic |
Canonical SMILES | N=c1nc(O)c2nc(CNc3ccc(C(=O)N[C@@H](CCC(=O)O)C(=O)O)cc3)cnc2[nH]1 |
2D SMILES | N=c1nc(O)c2nc(CNc3ccc(C(=O)NC(CCC(=O)O)C(=O)O)cc3)cnc2[nH]1 |
IUPAC name | (2S)-2-[(4-{[(4-hydroxy-2-imino-1,2-dihydropteridin-6-yl)methyl]amino}phenyl)formamido]pentanedioic acid |
InChI | InChI=1S/C19H19N7O6/c20-19-25-15-14(17(30)26-19)23-11(8-22-15)7-21-10-3-1-9(2-4-10)16(29)24-12(18(31)32)5-6-13(27)28/h1-4,8,12,21H,5-7H2,(H,24,29)(H,27,28)(H,31,32)(H3,20,22,25,26,30)/t12-/m0/s1 |
InChIKey | OVBPIULPVIDEAO-LBPRGKRZSA-N |
Deep SMILES | could not be computed |
Murcko Framework | n1cnc2ncc(nc2c1)CNc3ccccc3 |
Pathway | Superclass | Class |
Alkaloids|Alkaloids | |Pseudoalkaloids (transamidation) | |pteridine alkaloids |
Total atom number | 51 |
Heavy atom number | 32 |
Bond count | 34 |
Number of carbons | 19 |
Minimal number of rings | 3 |
Maximal number of rings | 4 |
NP-likeness score | 1.33 |
Alogp | 1.13 |
Alogp2 | 1.29 |
Apol | 58.6211 |
Bpol | 29.5849 |
EccentricConnectivityIndexDescriptor | 986 |
FmfDescriptor | 0.5625 |
Fsp3 | 0.2105 |
FragmentComplexityDescriptor | 1817.13 |
PetitjeanNumber | 0.4737 |
LipinskiRuleOf5Failures | 2 |
WienerPathNumber | 3626 |
Xlogp | -1.638 |
ZagrebIndex | 162 |
TopoPSA | 214.27 |