Name | (4s,4ar,8as)-3,4a,8,8-tetramethyl-4-(3-oxobutyl)-5,6,7,8a-tetrahydro-4h-naphthalen-1-one |
Wikidata | Q105177709 |
Mol. formula | C18H28O2 |
CAS registry number | - |
Mol. weight | 276.4144 |
Temporary LOTUS id | LTS0212790 |
Name | (4s,4ar,8as)-3,4a,8,8-tetramethyl-4-(3-oxobutyl)-5,6,7,8a-tetrahydro-4h-naphthalen-1-one |
Canonical SMILES | CC(=O)CC[C@H]1C(C)=CC(=O)[C@H]2C(C)(C)CCC[C@@]21C |
2D SMILES | CC(=O)CCC1C(C)=CC(=O)C2C(C)(C)CCCC12C |
IUPAC name | (4S,4aR,8aS)-3,4a,8,8-tetramethyl-4-(3-oxobutyl)-1,4,4a,5,6,7,8,8a-octahydronaphthalen-1-one |
InChI | InChI=1S/C18H28O2/c1-12-11-15(20)16-17(3,4)9-6-10-18(16,5)14(12)8-7-13(2)19/h11,14,16H,6-10H2,1-5H3/t14-,16-,18+/m0/s1 |
InChIKey | NDTDEVRGTYZRRA-QILLFSRXSA-N |
Deep SMILES | could not be computed |
Murcko Framework | C1=CCC2CCCCC2C1 |
Pathway | Superclass | Class |
Terpenoids | Diterpenoids | Norlabdane diterpenoids |
Total atom number | 48 |
Heavy atom number | 20 |
Bond count | 21 |
Number of carbons | 18 |
Minimal number of rings | 2 |
Maximal number of rings | 3 |
NP-likeness score | 1.05 |
Alogp | 3.36 |
Alogp2 | 11.32 |
Apol | 51.9542 |
Bpol | 32.5258 |
EccentricConnectivityIndexDescriptor | 263 |
FmfDescriptor | 0.5 |
Fsp3 | 0.7778 |
FragmentComplexityDescriptor | 2021.02 |
PetitjeanNumber | 0.5 |
LipinskiRuleOf5Failures | 0 |
WienerPathNumber | 719 |
Xlogp | 4.22 |
ZagrebIndex | 108 |
TopoPSA | 34.14 |