Name | [(6r)-4,4,6-trimethylcyclohex-1-en-1-yl]methyl propanoate |
Wikidata | Q105338035 |
Mol. formula | C13H22O2 |
CAS registry number | - |
Mol. weight | 210.3131 |
Temporary LOTUS id | LTS0211636 |
Name | [(6r)-4,4,6-trimethylcyclohex-1-en-1-yl]methyl propanoate |
Canonical SMILES | CCC(=O)OCC1=CCC(C)(C)C[C@H]1C |
2D SMILES | CCC(=O)OCC1=CCC(C)(C)CC1C |
IUPAC name | [(6R)-4,4,6-trimethylcyclohex-1-en-1-yl]methyl propanoate |
InChI | InChI=1S/C13H22O2/c1-5-12(14)15-9-11-6-7-13(3,4)8-10(11)2/h6,10H,5,7-9H2,1-4H3/t10-/m1/s1 |
InChIKey | XOZBCNJUNGIXPL-SNVBAGLBSA-N |
Deep SMILES | could not be computed |
Murcko Framework | C1=CCCCC1 |
Pathway | Superclass | Class |
Terpenoids|Terpenoids | |Monoterpenoids | |Monocyclic monoterpenoids |
Total atom number | 37 |
Heavy atom number | 15 |
Bond count | 15 |
Number of carbons | 13 |
Minimal number of rings | 1 |
Maximal number of rings | 1 |
NP-likeness score | 1.01 |
Alogp | 3.4 |
Alogp2 | 11.59 |
Apol | 39.1534 |
Bpol | 26.9246 |
EccentricConnectivityIndexDescriptor | 206 |
FmfDescriptor | 0.4 |
Fsp3 | 0.7692 |
FragmentComplexityDescriptor | 1159.02 |
PetitjeanNumber | 0.4444 |
LipinskiRuleOf5Failures | 0 |
WienerPathNumber | 398 |
Xlogp | 3.69 |
ZagrebIndex | 72 |
TopoPSA | 26.3 |