Name | Tripteroside |
Wikidata | Q27108487 |
Mol. formula | C19H18O11 |
CAS registry number | - |
Mol. weight | 422.3404 |
Temporary LOTUS id | LTS0210431 |
Name | Tripteroside |
Canonical SMILES | O=c1c2cc(O)c(O[C@@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3O)cc2oc2cc(O)cc(O)c12 |
2D SMILES | O=c1c2cc(O)c(OC3OC(CO)C(O)C(O)C3O)cc2oc2cc(O)cc(O)c12 |
IUPAC name | 1,3,7-trihydroxy-6-{[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy}-9H-xanthen-9-one |
InChI | InChI=1S/C19H18O11/c20-5-13-16(25)17(26)18(27)19(30-13)29-11-4-10-7(3-8(11)22)15(24)14-9(23)1-6(21)2-12(14)28-10/h1-4,13,16-23,25-27H,5H2/t13-,16-,17+,18-,19-/m1/s1 |
InChIKey | DSJIWZUDANJKCU-LQDZTQBFSA-N |
Deep SMILES | could not be computed |
Murcko Framework | O1c2ccccc2Cc3ccccc13 |
Pathway | Superclass | Class |
Shikimates and Phenylpropanoids | Xanthones | Plant xanthones |
Total atom number | 48 |
Heavy atom number | 30 |
Bond count | 33 |
Number of carbons | 19 |
Minimal number of rings | 4 |
Maximal number of rings | 7 |
NP-likeness score | 1 |
Alogp | 0.25 |
Alogp2 | 0.06 |
Apol | 54.2643 |
Bpol | 26.3837 |
EccentricConnectivityIndexDescriptor | 671 |
FmfDescriptor | 0.7 |
Fsp3 | 0.3158 |
FragmentComplexityDescriptor | 1731.11 |
PetitjeanNumber | 0.4615 |
LipinskiRuleOf5Failures | 1 |
WienerPathNumber | 2428 |
Xlogp | 1.014 |
ZagrebIndex | 166 |
TopoPSA | 190.28 |