Name | 7-isopropyl-3-methoxy-1,4a-dimethyl-5,6-dihydronaphthalen-2-one |
Wikidata | Q104995358 |
Mol. formula | C16H22O2 |
CAS registry number | - |
Mol. weight | 246.3453 |
Temporary LOTUS id | LTS0210225 |
Name | 7-isopropyl-3-methoxy-1,4a-dimethyl-5,6-dihydronaphthalen-2-one |
Canonical SMILES | COC1=CC2(C)CCC(C(C)C)=CC2=C(C)C1=O |
2D SMILES | COC1=CC2(C)CCC(C(C)C)=CC2=C(C)C1=O |
IUPAC name | 3-methoxy-1,4a-dimethyl-7-(propan-2-yl)-2,4a,5,6-tetrahydronaphthalen-2-one |
InChI | InChI=1S/C16H22O2/c1-10(2)12-6-7-16(4)9-14(18-5)15(17)11(3)13(16)8-12/h8-10H,6-7H2,1-5H3 |
InChIKey | FHNDXUYNRPSKDT-UHFFFAOYSA-N |
Deep SMILES | could not be computed |
Murcko Framework | C1=CCCC2C=CCC=C12 |
Pathway | Superclass | Class |
Terpenoids|Terpenoids | Sesquiterpenoids|Sesquiterpenoids | Daucane sesquiterpenoids|Eudesmane sesquiterpenoids |
Total atom number | 40 |
Heavy atom number | 18 |
Bond count | 19 |
Number of carbons | 16 |
Minimal number of rings | 2 |
Maximal number of rings | 3 |
NP-likeness score | 1.08 |
Alogp | 3.23 |
Alogp2 | 10.44 |
Apol | 44.4334 |
Bpol | 26.9246 |
EccentricConnectivityIndexDescriptor | 242 |
FmfDescriptor | 0.5556 |
Fsp3 | 0.5625 |
FragmentComplexityDescriptor | 1375.02 |
PetitjeanNumber | 0.4444 |
LipinskiRuleOf5Failures | 0 |
WienerPathNumber | 552 |
Xlogp | 4.071 |
ZagrebIndex | 96 |
TopoPSA | 26.3 |