Name | 6-ethenyl-6,8-dimethyl-3-methylidene-2,7-dioxo-hexahydrocycloocta[b]furan-4-yl 2-(hydroxymethyl)but-2-enoate |
Wikidata | Q105146051 |
Mol. formula | C20H26O6 |
CAS registry number | - |
Mol. weight | 362.4176 |
Temporary LOTUS id | LTS0209945 |
Name | 6-ethenyl-6,8-dimethyl-3-methylidene-2,7-dioxo-hexahydrocycloocta[b]furan-4-yl 2-(hydroxymethyl)but-2-enoate |
Canonical SMILES | C=CC1(C)CC(OC(=O)C(=CC)CO)C2C(=C)C(=O)OC2CC(C)C1=O |
2D SMILES | C=CC1(C)CC(OC(=O)C(=CC)CO)C2C(=C)C(=O)OC2CC(C)C1=O |
IUPAC name | 6-ethenyl-6,8-dimethyl-3-methylidene-2,7-dioxo-decahydrocycloocta[b]furan-4-yl 2-(hydroxymethyl)but-2-enoate |
InChI | InChI=1S/C20H26O6/c1-6-13(10-21)19(24)26-15-9-20(5,7-2)17(22)11(3)8-14-16(15)12(4)18(23)25-14/h6-7,11,14-16,21H,2,4,8-10H2,1,3,5H3 |
InChIKey | KUBCFNJIKFBWBC-UHFFFAOYSA-N |
Deep SMILES | could not be computed |
Murcko Framework | O1CCC2CCCCCCC12 |
Pathway | Superclass | Class |
Terpenoids | Sesquiterpenoids | Elemane sesquiterpenoids |
Total atom number | 52 |
Heavy atom number | 26 |
Bond count | 27 |
Number of carbons | 20 |
Minimal number of rings | 2 |
Maximal number of rings | 3 |
NP-likeness score | 0.99 |
Alogp | 2.42 |
Alogp2 | 5.85 |
Apol | 57.3486 |
Bpol | 35.1294 |
EccentricConnectivityIndexDescriptor | 412 |
FmfDescriptor | 0.4231 |
Fsp3 | 0.55 |
FragmentComplexityDescriptor | 2159.06 |
PetitjeanNumber | 0.5 |
LipinskiRuleOf5Failures | 0 |
WienerPathNumber | 1491 |
Xlogp | 2.019 |
ZagrebIndex | 134 |
TopoPSA | 89.9 |