Name | (2e,4e,6z,8e)-n-(2-methylpropyl)deca-2,4,6,8-tetraenimidic acid |
Wikidata | Q105256381 |
Mol. formula | C14H21NO |
CAS registry number | - |
Mol. weight | 219.3232 |
Temporary LOTUS id | LTS0209188 |
Name | (2e,4e,6z,8e)-n-(2-methylpropyl)deca-2,4,6,8-tetraenimidic acid |
Canonical SMILES | C/C=C/C=C\C=C\C=C\C(O)=NCC(C)C |
2D SMILES | CC=CC=CC=CC=CC(O)=NCC(C)C |
IUPAC name | (2E,4E,6Z,8E)-N-(2-methylpropyl)deca-2,4,6,8-tetraenimidic acid |
InChI | InChI=1S/C14H21NO/c1-4-5-6-7-8-9-10-11-14(16)15-12-13(2)3/h4-11,13H,12H2,1-3H3,(H,15,16)/b5-4+,7-6-,9-8+,11-10+ |
InChIKey | SNFDOCOZZFRJEQ-CDOSPGSVSA-N |
Deep SMILES | could not be computed |
Murcko Framework | not applicable |
Pathway | Superclass | Class |
Fatty acids | Fatty Acids and Conjugates | Branched fatty acids |
Total atom number | 37 |
Heavy atom number | 16 |
Bond count | 15 |
Number of carbons | 14 |
Minimal number of rings | 0 |
Maximal number of rings | 0 |
NP-likeness score | 1 |
Alogp | 3.38 |
Alogp2 | 11.44 |
Apol | 40.5447 |
Bpol | 24.2773 |
EccentricConnectivityIndexDescriptor | 298 |
FmfDescriptor | 0 |
Fsp3 | 0.3571 |
FragmentComplexityDescriptor | 1056.02 |
PetitjeanNumber | 0.4615 |
LipinskiRuleOf5Failures | 0 |
WienerPathNumber | 622 |
Xlogp | 4.104 |
ZagrebIndex | 62 |
TopoPSA | 32.59 |