Name | (3s)-2-acetyl-3-(1-methylhydrazin-1-yl)butanedioic acid; oxindole |
Wikidata | Q104964401 |
Mol. formula | C15H19N3O6 |
CAS registry number | - |
Mol. weight | 337.3285 |
Temporary LOTUS id | LTS0208986 |
Name | (3s)-2-acetyl-3-(1-methylhydrazin-1-yl)butanedioic acid; oxindole |
Canonical SMILES | CC(=O)C(C(=O)O)[C@@H](C(=O)O)N(C)N.OC1=Nc2ccccc2C1 |
2D SMILES | CC(=O)C(C(=O)O)C(C(=O)O)N(C)N.OC1=Nc2ccccc2C1 |
IUPAC name | (3S)-2-acetyl-3-(1-methylhydrazin-1-yl)butanedioic acid; 3H-indol-2-ol |
InChI | InChI=1S/C8H7NO.C7H12N2O5/c10-8-5-6-3-1-2-4-7(6)9-8;1-3(10)4(6(11)12)5(7(13)14)9(2)8/h1-4H,5H2,(H,9,10);4-5H,8H2,1-2H3,(H,11,12)(H,13,14)/t;4?,5-/m.0/s1 |
InChIKey | CMESIEJDJXFQEJ-IMPWDBNVSA-N |
Deep SMILES | could not be computed |
Murcko Framework | N1=CCc2ccccc12 |
Pathway | Superclass | Class |
Amino acids and Peptides | - | - |
Total atom number | 26 |
Heavy atom number | 14 |
Bond count | 24 |
Number of carbons | 15 |
Minimal number of rings | 2 |
Maximal number of rings | 3 |
NP-likeness score | 1.89 |
Alogp | -0.28 |
Alogp2 | 0.08 |
Apol | 47.1811 |
Bpol | 24.9649 |
EccentricConnectivityIndexDescriptor | 755359696 |
FmfDescriptor | 0.375 |
Fsp3 | 0.3333 |
FragmentComplexityDescriptor | 1297.09 |
PetitjeanNumber | 0.999 |
LipinskiRuleOf5Failures | 0 |
WienerPathNumber | 140000000253 |
Xlogp | -1.268 |
ZagrebIndex | 114 |
TopoPSA | 153.52 |