Name | 2-{3,5-dimethoxy-4-[(3-methylbut-2-en-1-yl)oxy]phenyl}-5,6,7-trimethoxychromen-4-one |
Wikidata | Q104993175 |
Mol. formula | C25H28O8 |
CAS registry number | - |
Mol. weight | 456.486 |
Temporary LOTUS id | LTS0208253 |
Name | 2-{3,5-dimethoxy-4-[(3-methylbut-2-en-1-yl)oxy]phenyl}-5,6,7-trimethoxychromen-4-one |
Canonical SMILES | COc1cc(-c2cc(=O)c3c(OC)c(OC)c(OC)cc3o2)cc(OC)c1OCC=C(C)C |
2D SMILES | COc1cc(-c2cc(=O)c3c(OC)c(OC)c(OC)cc3o2)cc(OC)c1OCC=C(C)C |
IUPAC name | 2-{3,5-dimethoxy-4-[(3-methylbut-2-en-1-yl)oxy]phenyl}-5,6,7-trimethoxy-4H-chromen-4-one |
InChI | InChI=1S/C25H28O8/c1-14(2)8-9-32-23-19(27-3)10-15(11-20(23)28-4)17-12-16(26)22-18(33-17)13-21(29-5)24(30-6)25(22)31-7/h8,10-13H,9H2,1-7H3 |
InChIKey | FCJULDZGZAWBOI-UHFFFAOYSA-N |
Deep SMILES | could not be computed |
Murcko Framework | O1c2ccccc2CC=C1c3ccccc3 |
Pathway | Superclass | Class |
Shikimates and Phenylpropanoids | Flavonoids | Flavones |
Total atom number | 61 |
Heavy atom number | 33 |
Bond count | 35 |
Number of carbons | 25 |
Minimal number of rings | 3 |
Maximal number of rings | 4 |
NP-likeness score | 1 |
Alogp | 5.2 |
Alogp2 | 27 |
Apol | 69.0862 |
Bpol | 44.9798 |
EccentricConnectivityIndexDescriptor | 833 |
FmfDescriptor | 0.4848 |
Fsp3 | 0.32 |
FragmentComplexityDescriptor | 2913.08 |
PetitjeanNumber | 0.5 |
LipinskiRuleOf5Failures | 1 |
WienerPathNumber | 3244 |
Xlogp | 5.309 |
ZagrebIndex | 168 |
TopoPSA | 85.59 |