Name | 3,3,7,9-tetramethyl-6-[(3-methylbutanoyl)oxy]-11-oxotricyclo[5.4.0.0²,⁸]undec-9-en-4-yl 2-methylbut-2-enoate |
Wikidata | Q105250042 |
Mol. formula | C25H36O5 |
CAS registry number | - |
Mol. weight | 416.5513 |
Temporary LOTUS id | LTS0206569 |
Name | 3,3,7,9-tetramethyl-6-[(3-methylbutanoyl)oxy]-11-oxotricyclo[5.4.0.0²,⁸]undec-9-en-4-yl 2-methylbut-2-enoate |
Canonical SMILES | CC=C(C)C(=O)OC1CC(OC(=O)CC(C)C)C2(C)C3C(=O)C=C(C)C2C3C1(C)C |
2D SMILES | CC=C(C)C(=O)OC1CC(OC(=O)CC(C)C)C2(C)C3C(=O)C=C(C)C2C3C1(C)C |
IUPAC name | 3,3,7,9-tetramethyl-6-[(3-methylbutanoyl)oxy]-11-oxotricyclo[5.4.0.0²,⁸]undec-9-en-4-yl 2-methylbut-2-enoate |
InChI | InChI=1S/C25H36O5/c1-9-14(4)23(28)30-17-12-18(29-19(27)10-13(2)3)25(8)20-15(5)11-16(26)21(25)22(20)24(17,6)7/h9,11,13,17-18,20-22H,10,12H2,1-8H3 |
InChIKey | SCDIIKOGQOUENK-UHFFFAOYSA-N |
Deep SMILES | could not be computed |
Murcko Framework | C1=CC2C3CCCCC2C3C1 |
Pathway | Superclass | Class |
Terpenoids | Sesquiterpenoids | Longipinane sesquiterpenoids |
Total atom number | 66 |
Heavy atom number | 30 |
Bond count | 32 |
Number of carbons | 25 |
Minimal number of rings | 3 |
Maximal number of rings | 7 |
NP-likeness score | 1.01 |
Alogp | 4.54 |
Alogp2 | 20.65 |
Apol | 72.0145 |
Bpol | 46.0615 |
EccentricConnectivityIndexDescriptor | 569 |
FmfDescriptor | 0.3667 |
Fsp3 | 0.72 |
FragmentComplexityDescriptor | 3754.05 |
PetitjeanNumber | 0.5 |
LipinskiRuleOf5Failures | 0 |
WienerPathNumber | 2192 |
Xlogp | 4.349 |
ZagrebIndex | 166 |
TopoPSA | 69.67 |