Name | (1s,2r,4s)-1-methyl-4-[(2s)-6-methylhept-5-en-2-yl]cyclohexane-1,2,4-triol |
Wikidata | Q104667758 |
Mol. formula | C15H28O3 |
CAS registry number | - |
Mol. weight | 256.3816 |
Temporary LOTUS id | LTS0206526 |
Name | (1s,2r,4s)-1-methyl-4-[(2s)-6-methylhept-5-en-2-yl]cyclohexane-1,2,4-triol |
Canonical SMILES | CC(C)=CCC[C@H](C)[C@]1(O)CC[C@](C)(O)[C@H](O)C1 |
2D SMILES | CC(C)=CCCC(C)C1(O)CCC(C)(O)C(O)C1 |
IUPAC name | (1S,2R,4S)-1-methyl-4-[(2S)-6-methylhept-5-en-2-yl]cyclohexane-1,2,4-triol |
InChI | InChI=1S/C15H28O3/c1-11(2)6-5-7-12(3)15(18)9-8-14(4,17)13(16)10-15/h6,12-13,16-18H,5,7-10H2,1-4H3/t12-,13+,14-,15-/m0/s1 |
InChIKey | LPCGSRPICJBRCD-XGUBFFRZSA-N |
Deep SMILES | could not be computed |
Murcko Framework | C1CCCCC1 |
Pathway | Superclass | Class |
Terpenoids | Sesquiterpenoids | Bisabolane sesquiterpenoids |
Total atom number | 46 |
Heavy atom number | 18 |
Bond count | 18 |
Number of carbons | 15 |
Minimal number of rings | 1 |
Maximal number of rings | 1 |
NP-likeness score | 1.73 |
Alogp | 2.25 |
Alogp2 | 5.07 |
Apol | 47.4762 |
Bpol | 30.6098 |
EccentricConnectivityIndexDescriptor | 274 |
FmfDescriptor | 0.3333 |
Fsp3 | 0.8667 |
FragmentComplexityDescriptor | 1810.03 |
PetitjeanNumber | 0.5 |
LipinskiRuleOf5Failures | 0 |
WienerPathNumber | 646 |
Xlogp | 2.903 |
ZagrebIndex | 90 |
TopoPSA | 60.69 |