Name | 4-(acetyloxy)-1-(3-phenylprop-2-enoyl)pyrrolidin-3-yl acetate |
Wikidata | Q104938175 |
Mol. formula | C17H19NO5 |
CAS registry number | - |
Mol. weight | 317.3371 |
Temporary LOTUS id | LTS0204280 |
Name | 4-(acetyloxy)-1-(3-phenylprop-2-enoyl)pyrrolidin-3-yl acetate |
Canonical SMILES | CC(=O)OC1CN(C(=O)C=Cc2ccccc2)CC1OC(C)=O |
2D SMILES | CC(=O)OC1CN(C(=O)C=Cc2ccccc2)CC1OC(C)=O |
IUPAC name | 4-(acetyloxy)-1-(3-phenylprop-2-enoyl)pyrrolidin-3-yl acetate |
InChI | InChI=1S/C17H19NO5/c1-12(19)22-15-10-18(11-16(15)23-13(2)20)17(21)9-8-14-6-4-3-5-7-14/h3-9,15-16H,10-11H2,1-2H3 |
InChIKey | BLUFKOASZPTGNZ-UHFFFAOYSA-N |
Deep SMILES | could not be computed |
Murcko Framework | c1ccc(cc1)C=CCN2CCCC2 |
Pathway | Superclass | Class |
Alkaloids | Ornithine alkaloids | - |
Total atom number | 42 |
Heavy atom number | 23 |
Bond count | 24 |
Number of carbons | 17 |
Minimal number of rings | 2 |
Maximal number of rings | 2 |
NP-likeness score | 0.94 |
Alogp | 1.27 |
Alogp2 | 1.61 |
Apol | 47.6991 |
Bpol | 29.4569 |
EccentricConnectivityIndexDescriptor | 451 |
FmfDescriptor | 0.6087 |
Fsp3 | 0.3529 |
FragmentComplexityDescriptor | 1343.06 |
PetitjeanNumber | 0.5 |
LipinskiRuleOf5Failures | 0 |
WienerPathNumber | 1325 |
Xlogp | 1.767 |
ZagrebIndex | 112 |
TopoPSA | 72.91 |