Name | Methyl (2e)-3-{4-hydroxy-3-[(2e)-4-hydroxy-3-methylbut-2-en-1-yl]phenyl}prop-2-enoate |
Wikidata | Q105203352 |
Mol. formula | C15H18O4 |
CAS registry number | - |
Mol. weight | 262.3016 |
Temporary LOTUS id | LTS0203709 |
Name | Methyl (2e)-3-{4-hydroxy-3-[(2e)-4-hydroxy-3-methylbut-2-en-1-yl]phenyl}prop-2-enoate |
Canonical SMILES | COC(=O)/C=C/c1ccc(O)c(C/C=C(\C)CO)c1 |
2D SMILES | COC(=O)C=Cc1ccc(O)c(CC=C(C)CO)c1 |
IUPAC name | methyl (2E)-3-{4-hydroxy-3-[(2E)-4-hydroxy-3-methylbut-2-en-1-yl]phenyl}prop-2-enoate |
InChI | InChI=1S/C15H18O4/c1-11(10-16)3-6-13-9-12(4-7-14(13)17)5-8-15(18)19-2/h3-5,7-9,16-17H,6,10H2,1-2H3/b8-5+,11-3+ |
InChIKey | OYJOYSKCSSWMJZ-GQHUZBHDSA-N |
Deep SMILES | could not be computed |
Murcko Framework | c1ccccc1 |
Pathway | Superclass | Class |
Shikimates and Phenylpropanoids | Phenylpropanoids (C6-C3) | Cinnamic acids and derivatives |
Total atom number | 37 |
Heavy atom number | 19 |
Bond count | 19 |
Number of carbons | 15 |
Minimal number of rings | 1 |
Maximal number of rings | 1 |
NP-likeness score | 1.01 |
Alogp | 2.65 |
Alogp2 | 7.03 |
Apol | 41.6103 |
Bpol | 22.5517 |
EccentricConnectivityIndexDescriptor | 335 |
FmfDescriptor | 0.3158 |
Fsp3 | 0.2667 |
FragmentComplexityDescriptor | 1027.04 |
PetitjeanNumber | 0.5 |
LipinskiRuleOf5Failures | 0 |
WienerPathNumber | 814 |
Xlogp | 1.611 |
ZagrebIndex | 86 |
TopoPSA | 66.76 |