Name | 9-[(5-methylfuran-2-yl)methyl]pyrido[3,4-b]indole |
Wikidata | Q105268940 |
Mol. formula | C17H14N2O |
CAS registry number | - |
Mol. weight | 262.3065 |
Temporary LOTUS id | LTS0201940 |
Name | 9-[(5-methylfuran-2-yl)methyl]pyrido[3,4-b]indole |
Canonical SMILES | Cc1ccc(Cn2c3ccccc3c3ccncc32)o1 |
2D SMILES | Cc1ccc(Cn2c3ccccc3c3ccncc32)o1 |
IUPAC name | 9-[(5-methylfuran-2-yl)methyl]-9H-pyrido[3,4-b]indole |
InChI | InChI=1S/C17H14N2O/c1-12-6-7-13(20-12)11-19-16-5-3-2-4-14(16)15-8-9-18-10-17(15)19/h2-10H,11H2,1H3 |
InChIKey | UANUGMASRPSVFK-UHFFFAOYSA-N |
Deep SMILES | could not be computed |
Murcko Framework | n1ccc2c3ccccc3n(c2c1)Cc4occc4 |
Pathway | Superclass | Class |
Alkaloids | Tryptophan alkaloids | Carboline alkaloids |
Total atom number | 34 |
Heavy atom number | 20 |
Bond count | 23 |
Number of carbons | 17 |
Minimal number of rings | 4 |
Maximal number of rings | 7 |
NP-likeness score | 1 |
Alogp | 3.5 |
Alogp2 | 12.27 |
Apol | 42.2571 |
Bpol | 20.5209 |
EccentricConnectivityIndexDescriptor | 326 |
FmfDescriptor | 0.95 |
Fsp3 | 0.1176 |
FragmentComplexityDescriptor | 989.03 |
PetitjeanNumber | 0.4444 |
LipinskiRuleOf5Failures | 0 |
WienerPathNumber | 756 |
Xlogp | 3.226 |
ZagrebIndex | 112 |
TopoPSA | 30.96 |