Name | 3-hydroxy-5-methoxybenzaldehyde |
Wikidata | Q82224622 |
Mol. formula | C8H8O3 |
CAS registry number | - |
Mol. weight | 152.1476 |
Temporary LOTUS id | LTS0201433 |
Name | 3-hydroxy-5-methoxybenzaldehyde |
Canonical SMILES | COc1cc(O)cc(C=O)c1 |
2D SMILES | COc1cc(O)cc(C=O)c1 |
IUPAC name | 3-hydroxy-5-methoxybenzaldehyde |
InChI | InChI=1S/C8H8O3/c1-11-8-3-6(5-9)2-7(10)4-8/h2-5,10H,1H3 |
InChIKey | FGQOOHJZONJGDT-UHFFFAOYSA-N |
Deep SMILES | could not be computed |
Murcko Framework | c1ccccc1 |
Pathway | Superclass | Class |
Shikimates and Phenylpropanoids | - | - |
Total atom number | 19 |
Heavy atom number | 11 |
Bond count | 11 |
Number of carbons | 8 |
Minimal number of rings | 1 |
Maximal number of rings | 1 |
NP-likeness score | 1 |
Alogp | 1.31 |
Alogp2 | 1.7 |
Apol | 21.8203 |
Bpol | 11.6197 |
EccentricConnectivityIndexDescriptor | 101 |
FmfDescriptor | 0.5455 |
Fsp3 | 0.125 |
FragmentComplexityDescriptor | 251.03 |
PetitjeanNumber | 0.3333 |
LipinskiRuleOf5Failures | 0 |
WienerPathNumber | 154 |
Xlogp | 1.227 |
ZagrebIndex | 50 |
TopoPSA | 46.53 |