Name | (1s,3r,8r,8as)-1-hydroxy-3,8-dimethyl-5-(prop-1-en-2-yl)-3,4,6,7,8,8a-hexahydro-1h-naphthalen-2-one |
Wikidata | Q104992191 |
Mol. formula | C15H22O2 |
CAS registry number | - |
Mol. weight | 234.3345 |
Temporary LOTUS id | LTS0199894 |
Name | (1s,3r,8r,8as)-1-hydroxy-3,8-dimethyl-5-(prop-1-en-2-yl)-3,4,6,7,8,8a-hexahydro-1h-naphthalen-2-one |
Canonical SMILES | C=C(C)C1=C2C[C@@H](C)C(=O)[C@@H](O)[C@H]2[C@H](C)CC1 |
2D SMILES | C=C(C)C1=C2CC(C)C(=O)C(O)C2C(C)CC1 |
IUPAC name | (1S,3R,8R,8aS)-1-hydroxy-3,8-dimethyl-5-(prop-1-en-2-yl)-1,2,3,4,6,7,8,8a-octahydronaphthalen-2-one |
InChI | InChI=1S/C15H22O2/c1-8(2)11-6-5-9(3)13-12(11)7-10(4)14(16)15(13)17/h9-10,13,15,17H,1,5-7H2,2-4H3/t9-,10-,13+,15+/m1/s1 |
InChIKey | FADWFQYYMOXRJB-NRWDQBFYSA-N |
Deep SMILES | could not be computed |
Murcko Framework | C1=C2CCCCC2CCC1 |
Pathway | Superclass | Class |
Terpenoids | Sesquiterpenoids | Cadinane sesquiterpenoids |
Total atom number | 39 |
Heavy atom number | 17 |
Bond count | 18 |
Number of carbons | 15 |
Minimal number of rings | 2 |
Maximal number of rings | 3 |
NP-likeness score | 1.03 |
Alogp | 3.03 |
Alogp2 | 9.17 |
Apol | 42.6734 |
Bpol | 25.0086 |
EccentricConnectivityIndexDescriptor | 191 |
FmfDescriptor | 0.5882 |
Fsp3 | 0.6667 |
FragmentComplexityDescriptor | 1328.02 |
PetitjeanNumber | 0.4286 |
LipinskiRuleOf5Failures | 0 |
WienerPathNumber | 454 |
Xlogp | 2.661 |
ZagrebIndex | 90 |
TopoPSA | 37.3 |