Name | 2-{[6-hydroxy-3,4-bis(4-hydroxy-3-methoxyphenyl)hexyl]oxy}-6-(hydroxymethyl)oxane-3,4,5-triol |
Wikidata | Q104934857 |
Mol. formula | C26H36O11 |
CAS registry number | - |
Mol. weight | 524.5585 |
Temporary LOTUS id | LTS0197970 |
Name | 2-{[6-hydroxy-3,4-bis(4-hydroxy-3-methoxyphenyl)hexyl]oxy}-6-(hydroxymethyl)oxane-3,4,5-triol |
Canonical SMILES | COc1cc(C(CCO)C(CCOC2OC(CO)C(O)C(O)C2O)c2ccc(O)c(OC)c2)ccc1O |
2D SMILES | COc1cc(C(CCO)C(CCOC2OC(CO)C(O)C(O)C2O)c2ccc(O)c(OC)c2)ccc1O |
IUPAC name | 2-{[6-hydroxy-3,4-bis(4-hydroxy-3-methoxyphenyl)hexyl]oxy}-6-(hydroxymethyl)oxane-3,4,5-triol |
InChI | InChI=1S/C26H36O11/c1-34-20-11-14(3-5-18(20)29)16(7-9-27)17(15-4-6-19(30)21(12-15)35-2)8-10-36-26-25(33)24(32)23(31)22(13-28)37-26/h3-6,11-12,16-17,22-33H,7-10,13H2,1-2H3 |
InChIKey | BFTMSSAJWZRYLC-UHFFFAOYSA-N |
Deep SMILES | could not be computed |
Murcko Framework | c1ccc(cc1)CCc2ccccc2 |
Pathway | Superclass | Class |
Shikimates and Phenylpropanoids|Shikimates and Phenylpropanoids | Lignans|Lignans | Arylnaphthalene and aryltetralin lignans| |
Total atom number | 73 |
Heavy atom number | 37 |
Bond count | 39 |
Number of carbons | 26 |
Minimal number of rings | 3 |
Maximal number of rings | 3 |
NP-likeness score | 1 |
Alogp | 0.91 |
Alogp2 | 0.83 |
Apol | 78.5865 |
Bpol | 47.0195 |
EccentricConnectivityIndexDescriptor | 863 |
FmfDescriptor | 0.6216 |
Fsp3 | 0.5385 |
FragmentComplexityDescriptor | 4293.11 |
PetitjeanNumber | 0.5 |
LipinskiRuleOf5Failures | 3 |
WienerPathNumber | 4332 |
Xlogp | 0.626 |
ZagrebIndex | 186 |
TopoPSA | 178.53 |