Name | 1,7,7,11,16,20,20-heptamethylpentacyclo[13.8.0.0³,¹².0⁶,¹¹.0¹⁶,²¹]tricos-3-ene-8,19-diol |
Wikidata | Q104398694 |
Mol. formula | C30H50O2 |
CAS registry number | - |
Mol. weight | 442.7179 |
Temporary LOTUS id | LTS0197893 |
Name | 1,7,7,11,16,20,20-heptamethylpentacyclo[13.8.0.0³,¹².0⁶,¹¹.0¹⁶,²¹]tricos-3-ene-8,19-diol |
Canonical SMILES | CC12CCC3C(C)(C)C(O)CCC3(C)C1CCC1C(=CCC3C(C)(C)C(O)CCC13C)C2 |
2D SMILES | CC12CCC3C(C)(C)C(O)CCC3(C)C1CCC1C(=CCC3C(C)(C)C(O)CCC13C)C2 |
IUPAC name | 1,7,7,11,16,20,20-heptamethylpentacyclo[13.8.0.0³,¹².0⁶,¹¹.0¹⁶,²¹]tricos-3-ene-8,19-diol |
InChI | InChI=1S/C30H50O2/c1-26(2)21-10-8-19-18-28(5)15-12-22-27(3,4)25(32)14-17-30(22,7)23(28)11-9-20(19)29(21,6)16-13-24(26)31/h8,20-25,31-32H,9-18H2,1-7H3 |
InChIKey | FMUNNDDBCLRMSL-UHFFFAOYSA-N |
Deep SMILES | could not be computed |
Murcko Framework | C1=C2CC3CCC4CCCCC4C3CCC2C5CCCCC5C1 |
Pathway | Superclass | Class |
Terpenoids | Triterpenoids | Serratane triterpenoids |
Total atom number | 82 |
Heavy atom number | 32 |
Bond count | 36 |
Number of carbons | 30 |
Minimal number of rings | 5 |
Maximal number of rings | 14 |
NP-likeness score | 1 |
Alogp | 6.45 |
Alogp2 | 41.63 |
Apol | 87.7436 |
Bpol | 54.6603 |
EccentricConnectivityIndexDescriptor | 701 |
FmfDescriptor | 0.7188 |
Fsp3 | 0.9333 |
FragmentComplexityDescriptor | 6404.02 |
PetitjeanNumber | 0.4615 |
LipinskiRuleOf5Failures | 1 |
WienerPathNumber | 2515 |
Xlogp | 9.2 |
ZagrebIndex | 196 |
TopoPSA | 40.46 |